| id | C00006499 |
|---|---|
| Name | 4',7,7''-Tri-O-methylamentoflavone / 7,4',7''-Tri-O-methylamentoflavone |
| CAS RN | 67882-13-7 |
| Standard InChI | InChI=1S/C33H24O10/c1-39-19-11-21(35)31-22(36)13-27(42-29(31)12-19)17-6-9-25(40-2)20(10-17)30-28(41-3)15-24(38)32-23(37)14-26(43-33(30)32)16-4-7-18(34)8-5-16/h4-15,34-35,38H,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C33H24O10/c1-39-19-11-21(35)31-22(36)13-27(42-29(31)12-19)17-6-9-25(40-2)20(10-17)30-28(41-3)15-24(38)32-23(37)14-26(43-33(30)32)16-4-7-18(34)8-5-16/h4-15,34-35,38H,1-3H3 |
| Phytochemical cluster | No. 18 |
|---|---|
| KCF-S cluster | No. 34 |
| By standard InChI | CHEMBL208578 |
|---|---|
| By standard InChI Main Layer | CHEMBL208578 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Spermatophyta | 3 |
| family name | count |
|---|---|
| Araucariaceae | 2 |
| Taxaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Araucaria angustifolia | 56992 | Araucariaceae | Spermatophyta | Viridiplantae |
| Araucaria excelsa | 50177 | Araucariaceae | Spermatophyta | Viridiplantae |
| Taxus baccata | 25629 | Taxaceae | Spermatophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P56817 | Beta-secretase 1 | A1A | CHEMBL208578 |
CHEMBL1211753
(1)
|
0 / 0 |