| id | C00006501 |
|---|---|
| Name | Amentoflavone 7,4',7'',4'''-tetramethyl ether |
| CAS RN | 3778-25-4 / 22783-08-0 |
| Standard InChI | InChI=1S/C34H26O10/c1-39-19-8-5-17(6-9-19)27-15-24(37)33-25(38)16-29(42-4)31(34(33)44-27)21-11-18(7-10-26(21)41-3)28-14-23(36)32-22(35)12-20(40-2)13-30(32)43-28/h5-16,35,38H,1-4H3 |
| Standard InChI (Main Layer) | InChI=1S/C34H26O10/c1-39-19-8-5-17(6-9-19)27-15-24(37)33-25(38)16-29(42-4)31(34(33)44-27)21-11-18(7-10-26(21)41-3)28-14-23(36)32-22(35)12-20(40-2)13-30(32)43-28/h5-16,35,38H,1-4H3 |
| Phytochemical cluster | No. 18 |
|---|---|
| KCF-S cluster | No. 34 |
| By standard InChI | CHEMBL378516 |
|---|---|
| By standard InChI Main Layer | CHEMBL378516 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Spermatophyta | 11 |
| family name | count |
|---|---|
| Podocarpaceae | 3 |
| Zamiaceae | 3 |
| Araucariaceae | 2 |
| Cephalotaxaceae | 1 |
| Cycadaceae | 1 |
| Cupressaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P56817 | Beta-secretase 1 | A1A | CHEMBL378516 |
CHEMBL1211753
(1)
|
0 / 0 |