| id | C00007423 |
|---|---|
| Name | Pentadecanoic acid / n-Pentadecanoic acid |
| CAS RN | 1002-84-2 |
| Standard InChI | InChI=1S/C15H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h2-14H2,1H3,(H,16,17) |
| Standard InChI (Main Layer) | InChI=1S/C15H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h2-14H2,1H3,(H,16,17) |
| Phytochemical cluster | No. 68 |
|---|---|
| KCF-S cluster | No. 184 |
| By standard InChI | CHEMBL460025 |
|---|---|
| By standard InChI Main Layer | CHEMBL460025 |
| By LinkDB | C16537 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 2 |
| family name | count |
|---|---|
| Brassicaceae | 2 |
| Ganodermataceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Arabidopsis thaliana | 3702 | Brassicaceae | rosids | Viridiplantae |
| Brassica hirta | 3728 | Brassicaceae | rosids | Viridiplantae |
| Ganoderma lucidum | 5315 | Ganodermataceae | Fungi | |
| Spongiporus leucomallellus (Murril) |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11511 | Cytochrome P450 19A1 | Cytochrome P450 19A1 | CHEMBL460025 |
CHEMBL976708
(1)
|
2 / 2 |