| id | C00008168 |
|---|---|
| Name | Desmethoxymatteucinol |
| CAS RN | 56297-79-1 |
| Standard InChI | InChI=1S/C17H16O4/c1-9-15(19)10(2)17-14(16(9)20)12(18)8-13(21-17)11-6-4-3-5-7-11/h3-7,13,19-20H,8H2,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C17H16O4/c1-9-15(19)10(2)17-14(16(9)20)12(18)8-13(21-17)11-6-4-3-5-7-11/h3-7,13,19-20H,8H2,1-2H3 |
| Phytochemical cluster | No. 14 |
|---|---|
| KCF-S cluster | No. 25 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL53439 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 3 |
| Magnoliophyta | 1 |
| asterids | 1 |
| Euphyllophyta | 1 |
| family name | count |
|---|---|
| Fabaceae | 2 |
| Ericaceae | 1 |
| Myricaceae | 1 |
| Annonaceae | 1 |
| Dryopteridaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q99700 | Ataxin-2 | Unclassified protein | CHEMBL53439 |
CHEMBL2114784
(1)
|
1 / 1 |
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL53439 |
CHEMBL914259
(1)
|
0 / 3 |
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL53439 |
CHEMBL914258
(1)
|
0 / 0 |
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL53439 |
CHEMBL1794401
(1)
|
0 / 0 |
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL53439 |
CHEMBL1794483
(1)
|
0 / 0 |