| id | C00008384 |
|---|---|
| Name | Kuwanon L |
| CAS RN | 88524-65-6 |
| Standard InChI | InChI=1S/C35H30O11/c1-15-8-22(19-4-2-16(36)10-25(19)40)31(34(44)20-5-3-17(37)11-26(20)41)23(9-15)32-24(39)7-6-21(35(32)45)29-14-28(43)33-27(42)12-18(38)13-30(33)46-29/h2-7,9-13,22-23,29,31,36-42,45H,8,14H2,1H3/t22-,23-,29?,31-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C35H30O11/c1-15-8-22(19-4-2-16(36)10-25(19)40)31(34(44)20-5-3-17(37)11-26(20)41)23(9-15)32-24(39)7-6-21(35(32)45)29-14-28(43)33-27(42)12-18(38)13-30(33)46-29/h2-7,9-13,22-23,29,31,36-42,45H,8,14H2,1H3 |
| Phytochemical cluster | No. 20 |
|---|---|
| KCF-S cluster | No. 81 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL377937 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Morus alba | 3498 | Moraceae | rosids | Viridiplantae |
| Morus mongolica | 229049 | Moraceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL377937 |
CHEMBL862180
(1)
|
0 / 0 |
| P51452 | Dual specificity protein phosphatase 3 | Ser_Thr_Tyr | CHEMBL377937 |
CHEMBL862182
(1)
|
0 / 0 |