| id | C00009504 |
|---|---|
| Name | Alpinumisoflavone dimethyl ether |
| CAS RN | 34086-56-1 |
| Standard InChI | InChI=1S/C22H20O5/c1-22(2)10-9-15-17(27-22)11-18-19(21(15)25-4)20(23)16(12-26-18)13-5-7-14(24-3)8-6-13/h5-12H,1-4H3 |
| Standard InChI (Main Layer) | InChI=1S/C22H20O5/c1-22(2)10-9-15-17(27-22)11-18-19(21(15)25-4)20(23)16(12-26-18)13-5-7-14(24-3)8-6-13/h5-12H,1-4H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 24 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Derris robusta | 1225697 | Fabaceae | rosids | Viridiplantae |
| Erythrina indica | 3845 | Fabaceae | rosids | Viridiplantae |
| Millettia thonningii | 53626 | Fabaceae | rosids | Viridiplantae |