| id | C00009575 | 
|---|---|
| Name | Amorphigenin / 8'-Hydroxyrotenone | 
| CAS RN | 4208-09-7 | 
| Standard InChI | InChI=1S/C23H22O7/c1-11(9-24)16-7-14-15(29-16)5-4-12-22(25)21-13-6-18(26-2)19(27-3)8-17(13)28-10-20(21)30-23(12)14/h4-6,8,16,20-21,24H,1,7,9-10H2,2-3H3 | 
| Standard InChI (Main Layer) | InChI=1S/C23H22O7/c1-11(9-24)16-7-14-15(29-16)5-4-12-22(25)21-13-6-18(26-2)19(27-3)8-17(13)28-10-20(21)30-23(12)14/h4-6,8,16,20-21,24H,1,7,9-10H2,2-3H3 | 
| Phytochemical cluster | No. 15 | 
|---|---|
| KCF-S cluster | No. 281 | 
| By standard InChI | CHEMBL1447847 | 
|---|---|
| By standard InChI Main Layer | CHEMBL465552 CHEMBL1447847 CHEMBL1490209 | 
| By LinkDB | 
|---|
| By CAS RN | C049148 | 
|---|
| class name | count | 
|---|---|
| rosids | 4 | 
| family name | count | 
|---|---|
| Fabaceae | 3 | 
| Rhamnaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Amorpha fruticosa | 48131 | Fabaceae | rosids | Viridiplantae | 
| Amorpha spp. | 3803 | Fabaceae | rosids | Viridiplantae | 
| Berchemia discolor | 72168 | Rhamnaceae | rosids | Viridiplantae | 
| Dalbergia monetaria | 450027 | Fabaceae | rosids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL1447847 | CHEMBL1614458
                        (1) | 0 / 0 | 
| P28482 | Mitogen-activated protein kinase 1 | Erk | CHEMBL1447847 | CHEMBL1613808
                        (1) | 0 / 0 | 
| P33261 | Cytochrome P450 2C19 | Cytochrome P450 2C19 | CHEMBL1490209 | CHEMBL1613777
                        (1) | 1 / 1 | 
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL1447847 | CHEMBL1614108
                        (1)
                        CHEMBL1613886
                        (1) | 0 / 1 | 
| P10636 | Microtubule-associated protein tau | Unclassified protein | CHEMBL1447847 | CHEMBL1614421
                        (1) | 4 / 3 | 
| O00255 | Menin | Unclassified protein | CHEMBL1447847 | CHEMBL1614531
                        (1) | 2 / 5 | 
| Q03164 | Histone-lysine N-methyltransferase 2A | Enzyme | CHEMBL1447847 | CHEMBL1614531
                        (1) | 1 / 3 | 
| compound | gene | gene name | gene description | interaction | interaction type | form | reference pmid | 
|---|---|---|---|---|---|---|---|
| C049148 | 5243 | ABCB1 ABC20 CD243 CLCS GP170 MDR1 P-GP PGY1 | ATP-binding cassette, sub-family B (MDR/TAP), member 1 (EC:3.6.3.44) | amorphigenin affects the activity of ABCB1 protein | affects activity | protein | 15796199 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #609535 | Drug metabolism, poor, cyp2c19-related | P33261 | 
| #600274 | Frontotemporal dementia; ftd | P10636 | 
| #605130 | Hairy elbows, short stature, facial dysmorphism, and developmental delay | Q03164 | 
| #145000 | Hyperparathyroidism 1; hrpt1 | O00255 | 
| #131100 | Multiple endocrine neoplasia, type i; men1 | O00255 | 
| #260540 | Parkinson-dementia syndrome | P10636 | 
| #172700 | Pick disease of brain | P10636 | 
| #601104 | Supranuclear palsy, progressive, 1; psnp1 | P10636 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00033 | Adrenal carcinoma | O00255
                            (related) | 
| H00034 | Carcinoid | O00255
                            (related) | 
| H00045 | Malignant islet cell carcinoma | O00255
                            (related) | 
| H00246 | Primary hyperparathyroidism | O00255
                            (related) | 
| H01102 | Pituitary adenomas | O00255
                            (related) | 
| H00036 | Osteosarcoma | P08684
                            (marker) | 
| H00058 | Amyotrophic lateral sclerosis (ALS) | P10636
                            (related) | 
| H00077 | Progressive supranuclear palsy (PSP) | P10636
                            (related) | 
| H00078 | Frontotemporal lobar degeneration (FTLD) | P10636
                            (related) | 
| H01171 | Poor drug metabolism (PM) | P33261
                            (related) | 
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) | Q03164
                            (related) Q03164 (marker) | 
| H00002 | Acute lymphoblastic leukemia (ALL) (precursor T lymphoblastic leukemia) | Q03164
                            (related) |