id | C00000010 |
---|---|
Name | Syringin |
CAS RN | 118-34-3 |
Standard InChI | InChI=1S/C17H24O9/c1-23-10-6-9(4-3-5-18)7-11(24-2)16(10)26-17-15(22)14(21)13(20)12(8-19)25-17/h3-4,6-7,12-15,17-22H,5,8H2,1-2H3/b4-3+/t12?,13-,14+,15?,17+/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C17H24O9/c1-23-10-6-9(4-3-5-18)7-11(24-2)16(10)26-17-15(22)14(21)13(20)12(8-19)25-17/h3-4,6-7,12-15,17-22H,5,8H2,1-2H3 |
Phytochemical cluster | No. 6 |
---|---|
KCF-S cluster | No. 678 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL250872 |
By LinkDB | C01533 |
---|
By CAS RN | C028305 |
---|
class name | count |
---|---|
asterids | 11 |
rosids | 9 |
Magnoliophyta | 3 |
eudicotyledons | 1 |
family name | count |
---|---|
Oleaceae | 4 |
Thymelaeaceae | 4 |
Magnoliaceae | 3 |
Apiaceae | 2 |
Asteraceae | 2 |
Styracaceae | 1 |
Rafflesiaceae | 1 |
Lamiaceae | 1 |
Fabaceae | 1 |
Plantaginaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL250872 |
CHEMBL1008496
(1)
|
0 / 0 |