| id | C00001042 |
|---|---|
| Name | 3,5,7-trimethoxyflavone / Galangin trimethyl ether / Galangin 3,5,7-trimethyl ether |
| CAS RN | 26964-29-4 |
| Standard InChI | InChI=1S/C18H16O5/c1-20-12-9-13(21-2)15-14(10-12)23-17(18(22-3)16(15)19)11-7-5-4-6-8-11/h4-10H,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C18H16O5/c1-20-12-9-13(21-2)15-14(10-12)23-17(18(22-3)16(15)19)11-7-5-4-6-8-11/h4-10H,1-3H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 35 |
| By standard InChI | CHEMBL75772 |
|---|---|
| By standard InChI Main Layer | CHEMBL75772 |
| By LinkDB | C10045 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 2 |
| eudicotyledons | 1 |
| asterids | 1 |
| Magnoliophyta | 1 |
| family name | count |
|---|---|
| Zingiberaceae | 2 |
| Amaranthaceae | 1 |
| Asteraceae | 1 |
| Lauraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Aniba riparia | 128591 | Lauraceae | Magnoliophyta | Viridiplantae |
| Boesenbergia pandurata | 97724 | Zingiberaceae | Liliopsida | Viridiplantae |
| Gomphrena martiana | 169521 | Amaranthaceae | eudicotyledons | Viridiplantae |
| Helichrysum nitens | 59430 | Asteraceae | asterids | Viridiplantae |
| Kaempferia parviflora | 97751 | Zingiberaceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P33765 | Adenosine receptor A3 | Adenosine receptor | CHEMBL75772 |
CHEMBL638578
(2)
CHEMBL641515
(1)
CHEMBL649050 (1) |
0 / 0 |