id | C00001042 |
---|---|
Name | 3,5,7-trimethoxyflavone / Galangin trimethyl ether / Galangin 3,5,7-trimethyl ether |
CAS RN | 26964-29-4 |
Standard InChI | InChI=1S/C18H16O5/c1-20-12-9-13(21-2)15-14(10-12)23-17(18(22-3)16(15)19)11-7-5-4-6-8-11/h4-10H,1-3H3 |
Standard InChI (Main Layer) | InChI=1S/C18H16O5/c1-20-12-9-13(21-2)15-14(10-12)23-17(18(22-3)16(15)19)11-7-5-4-6-8-11/h4-10H,1-3H3 |
Phytochemical cluster | No. 15 |
---|---|
KCF-S cluster | No. 35 |
By standard InChI | CHEMBL75772 |
---|---|
By standard InChI Main Layer | CHEMBL75772 |
By LinkDB | C10045 |
---|
By CAS RN |
---|
class name | count |
---|---|
Liliopsida | 2 |
eudicotyledons | 1 |
asterids | 1 |
Magnoliophyta | 1 |
family name | count |
---|---|
Zingiberaceae | 2 |
Amaranthaceae | 1 |
Asteraceae | 1 |
Lauraceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Aniba riparia | 128591 | Lauraceae | Magnoliophyta | Viridiplantae |
Boesenbergia pandurata | 97724 | Zingiberaceae | Liliopsida | Viridiplantae |
Gomphrena martiana | 169521 | Amaranthaceae | eudicotyledons | Viridiplantae |
Helichrysum nitens | 59430 | Asteraceae | asterids | Viridiplantae |
Kaempferia parviflora | 97751 | Zingiberaceae | Liliopsida | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P33765 | Adenosine receptor A3 | Adenosine receptor | CHEMBL75772 |
CHEMBL638578
(2)
CHEMBL641515
(1)
CHEMBL649050 (1) |
0 / 0 |