| id | C00010570 |
|---|---|
| Name | 8-Acetylharpagide / Harpagide 7-acetate / 8-O-Acetylharpagide |
| CAS RN | 6926-14-3 |
| Standard InChI | InChI=1S/C17H26O11/c1-7(19)28-16(2)5-9(20)17(24)3-4-25-15(13(16)17)27-14-12(23)11(22)10(21)8(6-18)26-14/h3-4,8-15,18,20-24H,5-6H2,1-2H3/t8?,9-,10-,11+,12?,13-,14?,15+,16+,17-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C17H26O11/c1-7(19)28-16(2)5-9(20)17(24)3-4-25-15(13(16)17)27-14-12(23)11(22)10(21)8(6-18)26-14/h3-4,8-15,18,20-24H,5-6H2,1-2H3 |
| Phytochemical cluster | No. 36 |
|---|---|
| KCF-S cluster | No. 56 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL523290 CHEMBL595293 |
| By LinkDB |
|---|
| By CAS RN | C077626 |
|---|
| class name | count |
|---|---|
| asterids | 12 |
| family name | count |
|---|---|
| Lamiaceae | 12 |
| Tenebrionidae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL523290 |
CHEMBL1794584
(1)
|
2 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #114500 | Colorectal cancer; crc |
P84022
|
| #613795 | Loeys-dietz syndrome, type 3; lds3 |
P84022
|