| id | C00001076 |
|---|---|
| Name | Nobiletin / 3',4',5,6,7,8-Hexamethoxyflavone |
| CAS RN | 478-01-3 |
| Standard InChI | InChI=1S/C21H22O8/c1-23-13-8-7-11(9-15(13)24-2)14-10-12(22)16-17(25-3)19(26-4)21(28-6)20(27-5)18(16)29-14/h7-10H,1-6H3 |
| Standard InChI (Main Layer) | InChI=1S/C21H22O8/c1-23-13-8-7-11(9-15(13)24-2)14-10-12(22)16-17(25-3)19(26-4)21(28-6)20(27-5)18(16)29-14/h7-10H,1-6H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 8 |
| By standard InChI | CHEMBL76447 |
|---|---|
| By standard InChI Main Layer | CHEMBL76447 |
| By LinkDB | C10112 |
|---|
| By CAS RN | C008661 |
|---|
| class name | count |
|---|---|
| asterids | 6 |
| rosids | 5 |
| Magnoliophyta | 1 |
| family name | count |
|---|---|
| Asteraceae | 6 |
| Rutaceae | 5 |
| Lauraceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O94956 | Solute carrier organic anion transporter family member 2B1 | Unclassified protein | CHEMBL76447 |
CHEMBL2076048
(1)
CHEMBL2076049
(1)
|
0 / 0 |
| Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | Enzyme | CHEMBL76447 |
CHEMBL1794585
(1)
|
0 / 0 |
| P47989 | Xanthine dehydrogenase/oxidase | Oxidoreductase | CHEMBL76447 |
CHEMBL1023248
(1)
|
1 / 1 |
| P08183 | Multidrug resistance protein 1 | drug | CHEMBL76447 |
CHEMBL2077289
(1)
CHEMBL2077300
(1)
CHEMBL2077305 (1) CHEMBL2076240 (1) |
1 / 0 |
| Q9NR56 | Muscleblind-like protein 1 | Unclassified protein | CHEMBL76447 |
CHEMBL1614166
(1)
|
1 / 0 |
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL76447 |
CHEMBL1614458
(2)
|
0 / 0 |
| Q92830 | Histone acetyltransferase KAT2A | Enzyme | CHEMBL76447 |
CHEMBL1738606
(1)
|
0 / 0 |
| O75496 | Geminin | Unclassified protein | CHEMBL76447 |
CHEMBL2114843
(1)
CHEMBL2114780
(1)
|
0 / 0 |
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL76447 |
CHEMBL2114788
(1)
CHEMBL2114931
(1)
|
0 / 0 |
| P37231 | Peroxisome proliferator-activated receptor gamma | NR1C3 | CHEMBL76447 |
CHEMBL1030212
(1)
|
5 / 3 |
| P28482 | Mitogen-activated protein kinase 1 | Erk | CHEMBL76447 |
CHEMBL1614521
(1)
CHEMBL1613808
(1)
|
0 / 0 |
| Q99714 | 3-hydroxyacyl-CoA dehydrogenase type-2 | Enzyme | CHEMBL76447 |
CHEMBL1613910
(1)
|
3 / 3 |
| Q9UNQ0 | ATP-binding cassette sub-family G member 2 | ATP binding cassette | CHEMBL76447 |
CHEMBL1687393
(1)
CHEMBL1687394
(1)
|
2 / 0 |
| P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD(+)] | Enzyme | CHEMBL76447 |
CHEMBL1614038
(1)
|
2 / 2 |
| Q96QE3 | ATPase family AAA domain-containing protein 5 | Unclassified protein | CHEMBL76447 |
CHEMBL1738588
(1)
|
0 / 0 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL76447 |
CHEMBL1614108
(1)
CHEMBL1613886
(1)
|
0 / 1 |
| P10636 | Microtubule-associated protein tau | Unclassified protein | CHEMBL76447 |
CHEMBL1614421
(1)
|
4 / 3 |
| B2RXH2 | Lysine-specific demethylase 4E | Enzyme | CHEMBL76447 |
CHEMBL1613914
(3)
|
0 / 0 |
| Q96KQ7 | Histone-lysine N-methyltransferase EHMT2 | Enzyme | CHEMBL76447 |
CHEMBL1738442
(1)
|
0 / 0 |
| O00255 | Menin | Unclassified protein | CHEMBL76447 |
CHEMBL1614257
(2)
|
2 / 5 |
| Q03164 | Histone-lysine N-methyltransferase 2A | Enzyme | CHEMBL76447 |
CHEMBL1614257
(2)
|
1 / 3 |
| Q13148 | TAR DNA-binding protein 43 | Unclassified protein | CHEMBL76447 |
CHEMBL2354287
(1)
|
1 / 1 |
| compound | gene | gene name | gene description | interaction | interaction type | form |
reference
pmid |
|---|---|---|---|---|---|---|---|
| C008661 | 972 |
CD74
DHLAG HLADG II Ia-GAMMA |
CD74 molecule, major histocompatibility complex, class II invariant chain | nobiletin results in decreased expression of CD74 mRNA |
decreases expression
|
mRNA |
18818744
|
| C008661 | 1543 |
CYP1A1
AHH AHRR CP11 CYP1 P1-450 P450-C P450DX |
cytochrome P450, family 1, subfamily A, polypeptide 1 (EC:1.14.14.1) | CYP1A1 protein results in increased metabolism of nobiletin |
increases metabolic processing
|
protein |
22743247
|
| C008661 | 1543 |
CYP1A1
AHH AHRR CP11 CYP1 P1-450 P450-C P450DX |
cytochrome P450, family 1, subfamily A, polypeptide 1 (EC:1.14.14.1) | nobiletin inhibits the reaction [DDT results in increased expression of CYP1A1 mRNA] |
decreases reaction
/ increases expression |
mRNA |
20865247
|
| C008661 | 1543 |
CYP1A1
AHH AHRR CP11 CYP1 P1-450 P450-C P450DX |
cytochrome P450, family 1, subfamily A, polypeptide 1 (EC:1.14.14.1) | nobiletin inhibits the reaction [Tetrachlorodibenzodioxin results in increased expression of CYP1A1 mRNA] |
decreases reaction
/ increases expression |
mRNA |
20865247
|
| C008661 | 1543 |
CYP1A1
AHH AHRR CP11 CYP1 P1-450 P450-C P450DX |
cytochrome P450, family 1, subfamily A, polypeptide 1 (EC:1.14.14.1) | nobiletin results in increased expression of CYP1A1 protein |
increases expression
|
protein |
22743247
|
| C008661 | 1544 |
CYP1A2
CP12 P3-450 P450(PA) |
cytochrome P450, family 1, subfamily A, polypeptide 2 (EC:1.14.14.1) | CYP1A2 protein results in increased metabolism of nobiletin |
increases metabolic processing
|
protein |
22743247
|
| C008661 | 1545 |
CYP1B1
CP1B CYPIB1 GLC3A P4501B1 |
cytochrome P450, family 1, subfamily B, polypeptide 1 (EC:1.14.14.1) | nobiletin results in increased expression of CYP1B1 mRNA |
increases expression
|
mRNA |
22743247
|
| C008661 | 4316 |
MMP7
MMP-7 MPSL1 PUMP-1 |
matrix metallopeptidase 7 (matrilysin, uterine) (EC:3.4.24.23) | nobiletin results in decreased expression of MMP7 mRNA |
decreases expression
|
mRNA |
15725655
|
| C008661 | 4316 |
MMP7
MMP-7 MPSL1 PUMP-1 |
matrix metallopeptidase 7 (matrilysin, uterine) (EC:3.4.24.23) | nobiletin results in decreased expression of MMP7 protein |
decreases expression
|
protein |
15725655
|
| OMIM | preferred title | UniProt |
|---|---|---|
| #300438 | 17-beta-hydroxysteroid dehydrogenase x deficiency |
Q99714
|
| #612069 | Amyotrophic lateral sclerosis 10, with or without frontotemporal dementia; als10 |
Q13148
|
| #614490 | Blood group, junior system; jr |
Q9UNQ0
|
| %606641 | Body mass index; bmi |
P37231
|
| #609338 | Carotid intimal medial thickness 1 |
P37231
|
| #119900 | Digital clubbing, isolated congenital |
P15428
|
| #600274 | Frontotemporal dementia; ftd |
P10636
|
| #137800 | Glioma susceptibility 1; glm1 |
P37231
|
| #605130 | Hairy elbows, short stature, facial dysmorphism, and developmental delay |
Q03164
|
| #145000 | Hyperparathyroidism 1; hrpt1 |
O00255
|
| #259100 | Hypertrophic osteoarthropathy, primary, autosomal recessive, 1; phoar1 |
P15428
|
| #612244 | Inflammatory bowel disease 13; ibd13 |
P08183
|
| #604367 | Lipodystrophy, familial partial, type 3; fpld3 |
P37231
|
| #300705 | Mental retardation, x-linked 17; mrx17 |
Q99714
|
| #300220 | Mental retardation, x-linked, syndromic 10; mrxs10 |
Q99714
|
| #131100 | Multiple endocrine neoplasia, type i; men1 |
O00255
|
| #160900 | Myotonic dystrophy 1; dm1 |
Q9NR56
|
| #601665 | Obesity |
P37231
|
| #260540 | Parkinson-dementia syndrome |
P10636
|
| #172700 | Pick disease of brain |
P10636
|
| #601104 | Supranuclear palsy, progressive, 1; psnp1 |
P10636
|
| #138900 | Uric acid concentration, serum, quantitative trait locus 1; uaqtl1 |
Q9UNQ0
|
| #278300 | Xanthinuria, type i |
P47989
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00033 | Adrenal carcinoma |
O00255
(related)
|
| H00034 | Carcinoid |
O00255
(related)
|
| H00045 | Malignant islet cell carcinoma |
O00255
(related)
|
| H00246 | Primary hyperparathyroidism |
O00255
(related)
|
| H01102 | Pituitary adenomas |
O00255
(related)
|
| H00036 | Osteosarcoma |
P08684
(marker)
|
| H00058 | Amyotrophic lateral sclerosis (ALS) |
P10636
(related)
Q13148 (related) |
| H00077 | Progressive supranuclear palsy (PSP) |
P10636
(related)
|
| H00078 | Frontotemporal lobar degeneration (FTLD) |
P10636
(related)
|
| H00457 | Primary hypertrophic osteoarthropathy (PHO) |
P15428
(related)
|
| H01246 | Isolated congenital nail clubbing (ICNC) |
P15428
(related)
|
| H00032 | Thyroid cancer |
P37231
(related)
|
| H00409 | Type II diabetes mellitus |
P37231
(related)
|
| H00420 | Familial partial lipodystrophy (FPL) |
P37231
(related)
|
| H00192 | Xanthinuria |
P47989
(related)
|
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) |
Q03164
(related)
Q03164 (marker) |
| H00002 | Acute lymphoblastic leukemia (ALL) (precursor T lymphoblastic leukemia) |
Q03164
(related)
|
| H00480 | Non-syndromic X-linked mental retardation |
Q99714
(related)
|
| H00658 | Syndromic X-linked mental retardation |
Q99714
(related)
|
| H00925 | 2-Methyl-3-hydroxybutyryl-CoA dehydrogenase (MHBD) deficiency |
Q99714
(related)
|