| id | C00000114 |
|---|---|
| Name | Tryptophol / Indole-3-ethanol |
| CAS RN | 526-55-6 |
| Standard InChI | InChI=1S/C10H11NO/c12-6-5-8-7-11-10-4-2-1-3-9(8)10/h1-4,7,11-12H,5-6H2 |
| Standard InChI (Main Layer) | InChI=1S/C10H11NO/c12-6-5-8-7-11-10-4-2-1-3-9(8)10/h1-4,7,11-12H,5-6H2 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 710 |
| By standard InChI | CHEMBL226545 |
|---|---|
| By standard InChI Main Layer | CHEMBL226545 |
| By LinkDB | C00955 |
|---|
| By CAS RN | C005949 |
|---|
| class name | count |
|---|---|
| rosids | 4 |
| Spermatophyta | 2 |
| asterids | 1 |
| family name | count |
|---|---|
| Fabaceae | 2 |
| Streptomycetaceae | 2 |
| Pinaceae | 2 |
| Phycomycetaceae | 1 |
| Asteraceae | 1 |
| Pichiaceae | 1 |
| Pleosporaceae | 1 |
| Saccharomycetaceae | 1 |
| Cucurbitaceae | 1 |
| Vitaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P38398 | Breast cancer type 1 susceptibility protein | Enzyme | CHEMBL226545 |
CHEMBL2114807
(1)
|
4 / 2 |
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL226545 |
CHEMBL2114788
(1)
|
0 / 0 |