id | C00000114 |
---|---|
Name | Tryptophol / Indole-3-ethanol |
CAS RN | 526-55-6 |
Standard InChI | InChI=1S/C10H11NO/c12-6-5-8-7-11-10-4-2-1-3-9(8)10/h1-4,7,11-12H,5-6H2 |
Standard InChI (Main Layer) | InChI=1S/C10H11NO/c12-6-5-8-7-11-10-4-2-1-3-9(8)10/h1-4,7,11-12H,5-6H2 |
Phytochemical cluster | No. 4 |
---|---|
KCF-S cluster | No. 710 |
By standard InChI | CHEMBL226545 |
---|---|
By standard InChI Main Layer | CHEMBL226545 |
By LinkDB | C00955 |
---|
By CAS RN | C005949 |
---|
class name | count |
---|---|
rosids | 4 |
Spermatophyta | 2 |
asterids | 1 |
family name | count |
---|---|
Fabaceae | 2 |
Streptomycetaceae | 2 |
Pinaceae | 2 |
Phycomycetaceae | 1 |
Asteraceae | 1 |
Pichiaceae | 1 |
Pleosporaceae | 1 |
Saccharomycetaceae | 1 |
Cucurbitaceae | 1 |
Vitaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P38398 | Breast cancer type 1 susceptibility protein | Enzyme | CHEMBL226545 |
CHEMBL2114807
(1)
|
4 / 2 |
P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL226545 |
CHEMBL2114788
(1)
|
0 / 0 |