| id | C00001406 |
|---|---|
| Name | D-Cathinone |
| CAS RN | 71031-15-7 |
| Standard InChI | InChI=1S/C9H11NO/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7H,10H2,1H3/t7-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C9H11NO/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7H,10H2,1H3 |
| Phytochemical cluster | No. 9 |
|---|---|
| KCF-S cluster | No. 2578 |
| By standard InChI | CHEMBL2104047 |
|---|---|
| By standard InChI Main Layer | CHEMBL1124 CHEMBL2104047 |
| By LinkDB | C08301 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 2 |
| family name | count |
|---|---|
| Celastraceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Catha edulis | 123405 | Celastraceae | rosids | Viridiplantae |
| Maytenus krukovii | 123430 | Celastraceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O94925 | Glutaminase kidney isoform, mitochondrial | Enzyme | CHEMBL2104047 |
CHEMBL2114738
(1)
|
0 / 0 |