| id | C00001513 |
|---|---|
| Name | Uracil |
| CAS RN | 66-22-8 |
| Standard InChI | InChI=1S/C4H4N2O2/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8) |
| Standard InChI (Main Layer) | InChI=1S/C4H4N2O2/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3873 |
| By standard InChI | CHEMBL566 |
|---|---|
| By standard InChI Main Layer | CHEMBL566 |
| By LinkDB | C00106 |
|---|
| By CAS RN | D014498 |
|---|
| class name | count |
|---|---|
| rosids | 4 |
| Liliopsida | 3 |
| eudicotyledons | 1 |
| asterids | 1 |
| family name | count |
|---|---|
| Moraceae | 1 |
| Ellisellidae | 1 |
| Enterobacteriaceae | 1 |
| Fabaceae | 1 |
| Cucurbitaceae | 1 |
| Araceae | 1 |
| Poaceae | 1 |
| Viscaceae | 1 |
| Subergorgiidae | 1 |
| Apiaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O75496 | Geminin | Unclassified protein | CHEMBL566 |
CHEMBL2114780
(1)
|
0 / 0 |
| Q13148 | TAR DNA-binding protein 43 | Unclassified protein | CHEMBL566 |
CHEMBL2354287
(1)
|
1 / 1 |
| compound | gene | gene name | gene description | interaction | interaction type | form |
reference
pmid |
|---|---|---|---|---|---|---|---|
| D014498 | 7157 |
TP53
BCC7 LFS1 P53 TRP53 |
tumor protein p53 | TP53 protein affects the susceptibility to [Uracil co-treated with Tegafur] |
affects cotreatment
/ affects response to substance |
protein |
15182437
|
| MeSH disease | OMIM | compound | disease name | evidence type |
reference
pmid |
|---|---|---|---|---|---|
| D006965 | D014498 | Hyperplasia |
marker/mechanism
|
3828979
|
|
| D007680 | D014498 | Kidney Neoplasms |
marker/mechanism
|
3828979
|
|
| D009362 | D014498 | Neoplasm Metastasis |
therapeutic
|
12720104
|
|
| D020163 | D014498 | Ornithine Carbamoyltransferase Deficiency Disease |
marker/mechanism
|
16435204
|
|
| D010212 | D014498 | Papilloma |
marker/mechanism
|
1752781
|
|
| D011230 | D014498 | Precancerous Conditions |
marker/mechanism
|
1752781
|
|
| D014516 | D014498 | Ureteral Neoplasms |
marker/mechanism
|
3828979
|
|
| D001749 | D014498 | Urinary Bladder Neoplasms |
marker/mechanism
therapeutic |
1752781
3828979 7505956 |