| id | C00001663 |
|---|---|
| Name | Songorin / Napellonin / Napellonine / Bullatine G |
| CAS RN | 509-24-0 |
| Standard InChI | InChI=1S/C22H31NO3/c1-4-23-10-20(3)6-5-17(25)22-15(20)7-13(18(22)23)21-9-12(11(2)19(21)26)14(24)8-16(21)22/h12-13,15-19,25-26H,2,4-10H2,1,3H3/t12-,13+,15-,16-,17+,18?,19-,20+,21+,22+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C22H31NO3/c1-4-23-10-20(3)6-5-17(25)22-15(20)7-13(18(22)23)21-9-12(11(2)19(21)26)14(24)8-16(21)22/h12-13,15-19,25-26H,2,4-10H2,1,3H3 |
| Phytochemical cluster | No. 10 |
|---|---|
| KCF-S cluster | No. 124 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1895895 CHEMBL2165580 |
| By LinkDB | C08707 |
|---|
| By CAS RN | C057217 |
|---|
| class name | count |
|---|---|
| eudicotyledons | 15 |
| family name | count |
|---|---|
| Ranunculaceae | 15 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL1895895 |
CHEMBL1794536
(1)
|
0 / 0 |