| id | C00023666 |
|---|---|
| Name | Altenusin |
| CAS RN | 31186-12-6 |
| Standard InChI | InChI=1S/C15H14O6/c1-7-3-11(16)12(17)6-9(7)10-4-8(21-2)5-13(18)14(10)15(19)20/h3-6,16-18H,1-2H3,(H,19,20) |
| Standard InChI (Main Layer) | InChI=1S/C15H14O6/c1-7-3-11(16)12(17)6-9(7)10-4-8(21-2)5-13(18)14(10)15(19)20/h3-6,16-18H,1-2H3,(H,19,20) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2383 |
| By standard InChI | CHEMBL483531 |
|---|---|
| By standard InChI Main Layer | CHEMBL483531 |
| By LinkDB |
|---|
| By CAS RN | C095643 |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Pleosporaceae | 5 |
| Corynesporascaceae | 1 |
| Aspergillaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Alternaria alternata | 5599 | Pleosporaceae | Fungi | |
| Alternaria citri | 135859 | Pleosporaceae | Fungi | |
| Alternaria dauci | 48095 | Pleosporaceae | Fungi | |
| Alternaria sp. | 5598 | Pleosporaceae | Fungi | |
| Alternaria tenuis | 509205 | Pleosporaceae | Fungi | |
| Corynespora smithii | 634374 | Corynesporascaceae | Fungi | |
| Penicillium simplicissimum IFM53375 | 5073 | Aspergillaceae | Fungi |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | Other cytosolic protein | CHEMBL483531 |
CHEMBL1614529
(1)
|
0 / 0 |
| Q9UIF8 | Bromodomain adjacent to zinc finger domain protein 2B | Unclassified protein | CHEMBL483531 |
CHEMBL1738312
(1)
|
0 / 0 |
| P08069 | Insulin-like growth factor 1 receptor | TK tyrosine-protein kinase INSR subfamily | CHEMBL483531 |
CHEMBL962870
(1)
|
1 / 3 |
| P06746 | DNA polymerase beta | Enzyme | CHEMBL483531 |
CHEMBL1614079
(1)
|
0 / 0 |
| P10253 | Lysosomal alpha-glucosidase | Hydrolase | CHEMBL483531 |
CHEMBL1614076
(1)
|
1 / 1 |
| O14965 | Aurora kinase A | Aur | CHEMBL483531 |
CHEMBL966176
(1)
|
0 / 0 |
| P37840 | Alpha-synuclein | Unclassified protein | CHEMBL483531 |
CHEMBL2354282
(1)
|
4 / 2 |
| P68400 | Casein kinase II subunit alpha | Ck2 | CHEMBL483531 |
CHEMBL962879
(1)
|
0 / 0 |
| P24941 | Cyclin-dependent kinase 2 | Cdc2 | CHEMBL483531 |
CHEMBL966179
(1)
|
0 / 0 |
| O00444 | Serine/threonine-protein kinase PLK4 | PLK serine/threonine protein kinase subfamily | CHEMBL483531 |
CHEMBL966209
(1)
|
0 / 0 |
| P00533 | Epidermal growth factor receptor | TK tyrosine-protein kinase EGFR subfamily | CHEMBL483531 |
CHEMBL962866
(1)
|
1 / 11 |
| P36888 | Receptor-type tyrosine-protein kinase FLT3 | Pdgfr | CHEMBL483531 |
CHEMBL962874
(1)
|
1 / 1 |
| P54760 | Ephrin type-B receptor 4 | Eph | CHEMBL483531 |
CHEMBL962867
(1)
|
0 / 0 |
| P39748 | Flap endonuclease 1 | Enzyme | CHEMBL483531 |
CHEMBL1794486
(1)
|
0 / 0 |
| Q92830 | Histone acetyltransferase KAT2A | Enzyme | CHEMBL483531 |
CHEMBL1738606
(1)
|
0 / 0 |
| P11413 | Glucose-6-phosphate 1-dehydrogenase | Enzyme | CHEMBL483531 |
CHEMBL1737961
(1)
|
1 / 2 |
| O75496 | Geminin | Unclassified protein | CHEMBL483531 |
CHEMBL2114843
(1)
|
0 / 0 |
| Q05397 | Focal adhesion kinase 1 | Fak | CHEMBL483531 |
CHEMBL962869
(1)
|
0 / 0 |
| Q02763 | Angiopoietin-1 receptor | Tie | CHEMBL483531 |
CHEMBL965366
(1)
|
1 / 1 |
| P63092 | Guanine nucleotide-binding protein G(s) subunit alpha isoforms short | Other membrane protein | CHEMBL483531 |
CHEMBL2114810
(1)
|
7 / 3 |
| Q9Y253 | DNA polymerase eta | Enzyme | CHEMBL483531 |
CHEMBL1794569
(1)
|
1 / 1 |
| O60285 | NUAK family SNF1-like kinase 1 | CAMK serine/threonine protein kinase NUAK subfamily | CHEMBL483531 |
CHEMBL966175
(1)
|
0 / 0 |
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL483531 |
CHEMBL1794401
(1)
|
0 / 0 |
| P06213 | Insulin receptor | TK tyrosine-protein kinase INSR subfamily | CHEMBL483531 |
CHEMBL962875
(1)
|
5 / 4 |
| P04626 | Receptor tyrosine-protein kinase erbB-2 | TK tyrosine-protein kinase EGFR subfamily | CHEMBL483531 |
CHEMBL962868
(1)
|
5 / 10 |
| P09619 | Platelet-derived growth factor receptor beta | Pdgfr | CHEMBL483531 |
CHEMBL962877
(1)
|
5 / 1 |
| P12931 | Proto-oncogene tyrosine-protein kinase Src | Src | CHEMBL483531 |
CHEMBL962871
(1)
|
0 / 0 |
| Q96GD4 | Aurora kinase B | Aur | CHEMBL483531 |
CHEMBL966177
(1)
|
0 / 0 |
| P35968 | Vascular endothelial growth factor receptor 2 | Vegfr | CHEMBL483531 |
CHEMBL962872
(1)
|
1 / 0 |
| P08581 | Hepatocyte growth factor receptor | TK tyrosine-protein kinase MET subfamily | CHEMBL483531 |
CHEMBL962876
(1)
|
2 / 3 |
| P28482 | Mitogen-activated protein kinase 1 | Erk | CHEMBL483531 |
CHEMBL1614521
(1)
|
0 / 0 |
| P35916 | Vascular endothelial growth factor receptor 3 | Vegfr | CHEMBL483531 |
CHEMBL962873
(1)
|
2 / 1 |
| P41279 | Mitogen-activated protein kinase kinase kinase 8 | Ste11 | CHEMBL483531 |
CHEMBL966181
(1)
|
0 / 0 |
| P53350 | Serine/threonine-protein kinase PLK1 | PLK serine/threonine protein kinase subfamily | CHEMBL483531 |
CHEMBL962878
(1)
|
0 / 0 |
| P31749 | RAC-alpha serine/threonine-protein kinase | Akt | CHEMBL483531 |
CHEMBL966174
(1)
|
4 / 1 |
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL483531 |
CHEMBL1794483
(1)
|
0 / 0 |
| O75164 | Lysine-specific demethylase 4A | Enzyme | CHEMBL483531 |
CHEMBL1737991
(1)
|
0 / 0 |
| P27695 | DNA-(apurinic or apyrimidinic site) lyase | Enzyme | CHEMBL483531 |
CHEMBL1614211
(1)
|
0 / 0 |
| P10636 | Microtubule-associated protein tau | Unclassified protein | CHEMBL483531 |
CHEMBL1614250
(1)
CHEMBL1614421
(1)
CHEMBL1614502 (1) |
4 / 3 |
| P11802 | Cyclin-dependent kinase 4 | CMGC serine/threonine protein kinase family | CHEMBL483531 |
CHEMBL966180
(1)
|
1 / 3 |
| Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL483531 |
CHEMBL1794536
(1)
|
0 / 0 |
| B2RXH2 | Lysine-specific demethylase 4E | Enzyme | CHEMBL483531 |
CHEMBL1613914
(1)
|
0 / 0 |
| P46063 | ATP-dependent DNA helicase Q1 | Enzyme | CHEMBL483531 |
CHEMBL1613829
(1)
CHEMBL1794433
(1)
|
0 / 0 |
| Q96KQ7 | Histone-lysine N-methyltransferase EHMT2 | Enzyme | CHEMBL483531 |
CHEMBL1738442
(1)
|
0 / 0 |
| Q13951 | Core-binding factor subunit beta | Unclassified protein | CHEMBL483531 |
CHEMBL1613933
(1)
|
0 / 1 |
| Q01196 | Runt-related transcription factor 1 | Unclassified protein | CHEMBL483531 |
CHEMBL1613933
(1)
|
1 / 6 |
| O94925 | Glutaminase kidney isoform, mitochondrial | Enzyme | CHEMBL483531 |
CHEMBL2114738
(1)
|
0 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #219080 | Acth-independent macronodular adrenal hyperplasia; aimah |
P63092
|
| #300908 | Anemia, nonspherocytic hemolytic, due to g6pd deficiency |
P11413
|
| #615007 | Basal ganglia calcification, idiopathic, 4; ibgc4 |
P09619
|
| #114480 | Breast cancer |
P31749
|
| #114500 | Colorectal cancer; crc |
P31749
|
| #615109 | Cowden syndrome 6; cws6 |
P31749
|
| #127750 | Dementia, lewy body; dlb |
P37840
|
| #610549 | Diabetes mellitus, insulin-resistant, with acanthosis nigricans |
P06213
|
| #125853 | Diabetes mellitus, noninsulin-dependent; niddm |
P06213
|
| #246200 | Donohue syndrome |
P06213
|
| #600274 | Frontotemporal dementia; ftd |
P10636
|
| #613659 | Gastric cancer |
P04626
|
| #137215 | Gastric cancer, hereditary diffuse; hdgc |
P04626
|
| #137800 | Glioma susceptibility 1; glm1 |
P04626
|
| #232300 | Glycogen storage disease ii |
P10253
|
| #602089 | Hemangioma, capillary infantile |
P35916
P35968 |
| #114550 | Hepatocellular carcinoma |
P08581
|
| #609968 | Hyperinsulinemic hypoglycemia, familial, 5; hhf5 |
P06213
|
| #270450 | Insulin-like growth factor i, resistance to |
P08069
|
| #607785 | Juvenile myelomonocytic leukemia; jmml |
P09619
|
| #601626 | Leukemia, acute myeloid; aml |
P09619
P36888 |
| #211980 | Lung cancer |
P00533
P04626 |
| #153100 | Lymphedema, hereditary, ia |
P35916
|
| #174800 | Mccune-albright syndrome; mas |
P63092
|
| #609048 | Melanoma, cutaneous malignant, susceptibility to, 3; cmm3 |
P11802
|
| #131440 | Myeloproliferative disorder, chronic, with eosinophilia |
P09619
|
| #228550 | Myofibromatosis, infantile, 1; imf1 |
P09619
|
| #166350 | Osseous heteroplasia, progressive; poh |
P63092
|
| #167000 | Ovarian cancer |
P04626
|
| #168601 | Parkinson disease 1, autosomal dominant; park1 |
P37840
|
| #605543 | Parkinson disease 4, autosomal dominant; park4 |
P37840
|
| #168600 | Parkinson disease, late-onset; pd |
P37840
|
| #260540 | Parkinson-dementia syndrome |
P10636
|
| #172700 | Pick disease of brain |
P10636
|
| #262190 | Pineal hyperplasia, insulin-resistant diabetes mellitus, and somatic abnormalities |
P06213
|
| #102200 | Pituitary adenoma, growth hormone-secreting |
P63092
|
| #601399 | Platelet disorder, familial, with associated myeloid malignancy |
Q01196
|
| #176920 | Proteus syndrome |
P31749
|
| #103580 | Pseudohypoparathyroidism, type ia; php1a |
P63092
|
| #603233 | Pseudohypoparathyroidism, type ib; php1b |
P63092
|
| #612462 | Pseudohypoparathyroidism, type ic; php1c |
P63092
|
| #605074 | Renal cell carcinoma, papillary, 1; rccp1 |
P08581
|
| #601104 | Supranuclear palsy, progressive, 1; psnp1 |
P10636
|
| #600195 | Venous malformations, multiple cutaneous and mucosal; vmcm |
Q02763
|
| #278750 | Xeroderma pigmentosum, variant type; xpv |
Q9Y253
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00016 | Oral cancer |
P00533
(related)
P00533 (marker) |
| H00017 | Esophageal cancer |
P00533
(related)
|
| H00018 | Gastric cancer |
P00533
(related)
P04626 (related) P08581 (related) |
| H00022 | Bladder cancer |
P00533
(related)
P04626 (related) |
| H00028 | Choriocarcinoma |
P00533
(related)
P04626 (related) |
| H00030 | Cervical cancer |
P00533
(related)
P04626 (related) P11802 (related) |
| H00042 | Glioma |
P00533
(related)
P00533 (marker) P09619 (related) P11802 (related) |
| H00055 | Laryngeal cancer |
P00533
(related)
P00533 (marker) |
| H00019 | Pancreatic cancer |
P04626
(related)
|
| H00026 | Endometrial Cancer |
P04626
(related)
|
| H00027 | Ovarian cancer |
P04626
(related)
|
| H00031 | Breast cancer |
P04626
(related)
P04626 (marker) |
| H00046 | Cholangiocarcinoma |
P04626
(related)
P08581 (related) |
| H00719 | Leprechaunism |
P06213
(related)
|
| H00942 | Rabson-Mendenhall syndrome |
P06213
(related)
|
| H01228 | Insulin-resistant diabetes mellitus with acanthosis nigricans (IRAN) |
P06213
(related)
|
| H01267 | Familial hyperinsulinemic hypoglycemia (HHF) |
P06213
(related)
|
| H00015 | Malignant pleural mesothelioma |
P08069
(related)
|
| H00050 | Synovial sarcoma |
P08069
(related)
|
| H01274 | Growth delay due to insulin-like growth factor I resistance |
P08069
(related)
|
| H00021 | Renal cell carcinoma |
P08581
(related)
|
| H00069 | Glycogen storage diseases (GSD) |
P10253
(related)
|
| H00058 | Amyotrophic lateral sclerosis (ALS) |
P10636
(related)
|
| H00077 | Progressive supranuclear palsy (PSP) |
P10636
(related)
|
| H00078 | Frontotemporal lobar degeneration (FTLD) |
P10636
(related)
|
| H00101 | Other phagocyte defects |
P11413
(related)
|
| H00668 | Anemia due to disorders of glutathione metabolism |
P11413
(related)
|
| H00038 | Malignant melanoma |
P11802
(related)
|
| H00539 | PTEN hamartoma tumor syndrome (PHTS) |
P31749
(related)
|
| H00535 | Lymphedemas |
P35916
(related)
|
| H00003 | Acute myeloid leukemia (AML) |
P36888
(related)
Q01196 (related) Q01196 (marker) Q13951 (marker) |
| H00057 | Parkinson's disease (PD) |
P37840
(related)
|
| H00066 | Lewy body dementia (LBD) |
P37840
(related)
|
| H00244 | Pseudohypoparathyroidism |
P63092
(related)
|
| H00441 | Progressive osseous heteroplasia (POH) |
P63092
(related)
|
| H00501 | Fibrous dysplasia, polyostotic |
P63092
(related)
|
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) |
Q01196
(related)
Q01196 (marker) |
| H00004 | Chronic myeloid leukemia (CML) |
Q01196
(related)
|
| H00978 | Thrombocytopenia (THC) |
Q01196
(related)
|
| H00531 | Venous malformations |
Q02763
(related)
|
| H00403 | Disorders of nucleotide excision repair |
Q9Y253
(related)
|