id | C00002493 |
---|---|
Name | Pimpinellin |
CAS RN | 131-12-4 |
Standard InChI | InChI=1S/C13H10O5/c1-15-11-7-3-4-9(14)18-10(7)8-5-6-17-12(8)13(11)16-2/h3-6H,1-2H3 |
Standard InChI (Main Layer) | InChI=1S/C13H10O5/c1-15-11-7-3-4-9(14)18-10(7)8-5-6-17-12(8)13(11)16-2/h3-6H,1-2H3 |
Phytochemical cluster | No. 25 |
---|---|
KCF-S cluster | No. 606 |
By standard InChI | CHEMBL1491809 |
---|---|
By standard InChI Main Layer | CHEMBL1491809 |
By LinkDB | C09285 |
---|
By CAS RN | C039409 |
---|
class name | count |
---|---|
asterids | 14 |
rosids | 13 |
Liliopsida | 1 |
family name | count |
---|---|
Apiaceae | 13 |
Moraceae | 12 |
Rutaceae | 1 |
Asteraceae | 1 |
Cyperaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL1491809 |
CHEMBL1614458
(1)
|
0 / 0 |
P16050 | Arachidonate 15-lipoxygenase | Enzyme | CHEMBL1491809 |
CHEMBL1614240
(1)
|
0 / 0 |
P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL1491809 |
CHEMBL1614108
(1)
CHEMBL1613886
(1)
|
0 / 1 |