| id | C00002493 |
|---|---|
| Name | Pimpinellin |
| CAS RN | 131-12-4 |
| Standard InChI | InChI=1S/C13H10O5/c1-15-11-7-3-4-9(14)18-10(7)8-5-6-17-12(8)13(11)16-2/h3-6H,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C13H10O5/c1-15-11-7-3-4-9(14)18-10(7)8-5-6-17-12(8)13(11)16-2/h3-6H,1-2H3 |
| Phytochemical cluster | No. 25 |
|---|---|
| KCF-S cluster | No. 606 |
| By standard InChI | CHEMBL1491809 |
|---|---|
| By standard InChI Main Layer | CHEMBL1491809 |
| By LinkDB | C09285 |
|---|
| By CAS RN | C039409 |
|---|
| class name | count |
|---|---|
| asterids | 14 |
| rosids | 13 |
| Liliopsida | 1 |
| family name | count |
|---|---|
| Apiaceae | 13 |
| Moraceae | 12 |
| Rutaceae | 1 |
| Asteraceae | 1 |
| Cyperaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL1491809 |
CHEMBL1614458
(1)
|
0 / 0 |
| P16050 | Arachidonate 15-lipoxygenase | Enzyme | CHEMBL1491809 |
CHEMBL1614240
(1)
|
0 / 0 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL1491809 |
CHEMBL1614108
(1)
CHEMBL1613886
(1)
|
0 / 1 |