| id | C00025220 |
|---|---|
| Name | Uncarin D / Uncarine D / Speciophylline |
| CAS RN | 4697-68-1 |
| Standard InChI | InChI=1S/C21H24N2O4/c1-12-14-10-23-8-7-21(16-5-3-4-6-17(16)22-20(21)25)18(23)9-13(14)15(11-27-12)19(24)26-2/h3-6,11-14,18H,7-10H2,1-2H3,(H,22,25)/t12-,13-,14-,18+,21-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C21H24N2O4/c1-12-14-10-23-8-7-21(16-5-3-4-6-17(16)22-20(21)25)18(23)9-13(14)15(11-27-12)19(24)26-2/h3-6,11-14,18H,7-10H2,1-2H3,(H,22,25) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 154 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL562222 CHEMBL1449034 CHEMBL1886339 CHEMBL2135897 CHEMBL2307077 CHEMBL2355088 |
| By LinkDB | C17596 |
|---|
| By CAS RN | C104393 |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Mitragyna hirsuta Havil | 170021 | Rubiaceae | asterids | Viridiplantae |
| Mitragyna speciosa Korth. | 170351 | Rubiaceae | asterids | Viridiplantae |
| Uncaria ferrea | 43574 | Rubiaceae | asterids | Viridiplantae |
| Uncaria homomalla Miq. | 43574 | Rubiaceae | asterids | Viridiplantae |
| Uncaria tomentosa | 128375 | Rubiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P10253 | Lysosomal alpha-glucosidase | Hydrolase | CHEMBL1449034 |
CHEMBL1614103
(1)
CHEMBL1614031
(1)
|
1 / 1 |
| P37840 | Alpha-synuclein | Unclassified protein | CHEMBL1449034 |
CHEMBL2354282
(1)
|
4 / 2 |
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL1449034 |
CHEMBL1614458
(1)
|
0 / 0 |
| P42858 | Huntingtin | Unclassified protein | CHEMBL1449034 |
CHEMBL1613918
(1)
|
1 / 1 |
| O75496 | Geminin | Unclassified protein | CHEMBL562222 CHEMBL1449034 |
CHEMBL2114843
(2)
|
0 / 0 |
| P63092 | Guanine nucleotide-binding protein G(s) subunit alpha isoforms short | Other membrane protein | CHEMBL562222 |
CHEMBL2114810
(1)
|
7 / 3 |
| P11308 | Transcriptional regulator ERG | Unclassified protein | CHEMBL1886339 |
CHEMBL2114924
(1)
|
1 / 2 |
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL562222 CHEMBL1449034 |
CHEMBL1794401
(2)
|
0 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #219080 | Acth-independent macronodular adrenal hyperplasia; aimah |
P63092
|
| #127750 | Dementia, lewy body; dlb |
P37840
|
| #612219 | Ewing sarcoma; es |
P11308
|
| #232300 | Glycogen storage disease ii |
P10253
|
| #143100 | Huntington disease; hd |
P42858
|
| #174800 | Mccune-albright syndrome; mas |
P63092
|
| #166350 | Osseous heteroplasia, progressive; poh |
P63092
|
| #168601 | Parkinson disease 1, autosomal dominant; park1 |
P37840
|
| #605543 | Parkinson disease 4, autosomal dominant; park4 |
P37840
|
| #168600 | Parkinson disease, late-onset; pd |
P37840
|
| #102200 | Pituitary adenoma, growth hormone-secreting |
P63092
|
| #103580 | Pseudohypoparathyroidism, type ia; php1a |
P63092
|
| #603233 | Pseudohypoparathyroidism, type ib; php1b |
P63092
|
| #612462 | Pseudohypoparathyroidism, type ic; php1c |
P63092
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00069 | Glycogen storage diseases (GSD) |
P10253
(related)
|
| H00024 | Prostate cancer |
P11308
(related)
|
| H00035 | Ewing's sarcoma |
P11308
(related)
|
| H00057 | Parkinson's disease (PD) |
P37840
(related)
|
| H00066 | Lewy body dementia (LBD) |
P37840
(related)
|
| H00059 | Huntington's disease (HD) |
P42858
(related)
|
| H00244 | Pseudohypoparathyroidism |
P63092
(related)
|
| H00441 | Progressive osseous heteroplasia (POH) |
P63092
(related)
|
| H00501 | Fibrous dysplasia, polyostotic |
P63092
(related)
|