| id | C00002672 |
|---|---|
| Name | Salicin / Saligenin beta-D-glucopyranoside |
| CAS RN | 138-52-3 |
| Standard InChI | InChI=1S/C13H18O7/c14-5-7-3-1-2-4-8(7)19-13-12(18)11(17)10(16)9(6-15)20-13/h1-4,9-18H,5-6H2/t9?,10-,11+,12?,13-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C13H18O7/c14-5-7-3-1-2-4-8(7)19-13-12(18)11(17)10(16)9(6-15)20-13/h1-4,9-18H,5-6H2 |
| Phytochemical cluster | No. 72 |
|---|---|
| KCF-S cluster | No. 45 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL334657 CHEMBL462997 CHEMBL1595746 |
| By LinkDB | C01451 |
|---|
| By CAS RN | C005696 |
|---|
| family name | count |
|---|---|
| Salicaceae | 4 |
| Adoxaceae | 1 |
| Cornaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Alangium chinense | 16897 | Cornaceae | asterids | Viridiplantae |
| Populus sieboldii | 3689 | Salicaceae | rosids | Viridiplantae |
| Populus spp. | 3689 | Salicaceae | rosids | Viridiplantae |
| Salix songorica | 40685 | Salicaceae | rosids | Viridiplantae |
| Salix spp. | 40685 | Salicaceae | rosids | Viridiplantae |
| Viburnum prunifolium | 237954 | Adoxaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL462997 |
CHEMBL973285
(1)
|
0 / 3 |
| P11216 | Glycogen phosphorylase, brain form | Enzyme | CHEMBL334657 |
CHEMBL680572
(1)
CHEMBL680573
(1)
|
0 / 0 |
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL462997 |
CHEMBL1794483
(1)
|
0 / 0 |
| P27695 | DNA-(apurinic or apyrimidinic site) lyase | Enzyme | CHEMBL1595746 |
CHEMBL1614211
(1)
|
0 / 0 |
| Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 | Enzyme | CHEMBL462997 |
CHEMBL1614364
(1)
|
1 / 1 |