id | C00002672 |
---|---|
Name | Salicin / Saligenin beta-D-glucopyranoside |
CAS RN | 138-52-3 |
Standard InChI | InChI=1S/C13H18O7/c14-5-7-3-1-2-4-8(7)19-13-12(18)11(17)10(16)9(6-15)20-13/h1-4,9-18H,5-6H2/t9?,10-,11+,12?,13-/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C13H18O7/c14-5-7-3-1-2-4-8(7)19-13-12(18)11(17)10(16)9(6-15)20-13/h1-4,9-18H,5-6H2 |
Phytochemical cluster | No. 72 |
---|---|
KCF-S cluster | No. 45 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL334657 CHEMBL462997 CHEMBL1595746 |
By LinkDB | C01451 |
---|
By CAS RN | C005696 |
---|
family name | count |
---|---|
Salicaceae | 4 |
Adoxaceae | 1 |
Cornaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Alangium chinense | 16897 | Cornaceae | asterids | Viridiplantae |
Populus sieboldii | 3689 | Salicaceae | rosids | Viridiplantae |
Populus spp. | 3689 | Salicaceae | rosids | Viridiplantae |
Salix songorica | 40685 | Salicaceae | rosids | Viridiplantae |
Salix spp. | 40685 | Salicaceae | rosids | Viridiplantae |
Viburnum prunifolium | 237954 | Adoxaceae | asterids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL462997 |
CHEMBL973285
(1)
|
0 / 3 |
P11216 | Glycogen phosphorylase, brain form | Enzyme | CHEMBL334657 |
CHEMBL680572
(1)
CHEMBL680573
(1)
|
0 / 0 |
Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL462997 |
CHEMBL1794483
(1)
|
0 / 0 |
P27695 | DNA-(apurinic or apyrimidinic site) lyase | Enzyme | CHEMBL1595746 |
CHEMBL1614211
(1)
|
0 / 0 |
Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 | Enzyme | CHEMBL462997 |
CHEMBL1614364
(1)
|
1 / 1 |