id | C00002744 |
---|---|
Name | Forsythiaside / Forsythoside A |
CAS RN | 79916-77-1 |
Standard InChI | InChI=1S/C29H36O15/c1-13-22(35)23(36)25(38)29(42-13)41-12-20-27(44-21(34)7-4-14-2-5-16(30)18(32)10-14)24(37)26(39)28(43-20)40-9-8-15-3-6-17(31)19(33)11-15/h2-7,10-11,13,20,22-33,35-39H,8-9,12H2,1H3/b7-4+/t13?,20?,22-,23?,24+,25-,26?,27+,28+,29+/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C29H36O15/c1-13-22(35)23(36)25(38)29(42-13)41-12-20-27(44-21(34)7-4-14-2-5-16(30)18(32)10-14)24(37)26(39)28(43-20)40-9-8-15-3-6-17(31)19(33)11-15/h2-7,10-11,13,20,22-33,35-39H,8-9,12H2,1H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 33 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL504363 |
By LinkDB | C10456 |
---|
By CAS RN | C058049 |
---|
class name | count |
---|---|
asterids | 7 |
family name | count |
---|---|
Oleaceae | 3 |
Plantaginaceae | 2 |
Lamiaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P17252 | Protein kinase C alpha type | Alpha | CHEMBL504363 |
CHEMBL997396
(1)
|
0 / 0 |