id | C00002864 |
---|---|
Name | Tectoquinone / 2-Methylanthraquinone / 2-Methylanthracene-9,10-dione |
CAS RN | 84-54-8 |
Standard InChI | InChI=1S/C15H10O2/c1-9-6-7-12-13(8-9)15(17)11-5-3-2-4-10(11)14(12)16/h2-8H,1H3 |
Standard InChI (Main Layer) | InChI=1S/C15H10O2/c1-9-6-7-12-13(8-9)15(17)11-5-3-2-4-10(11)14(12)16/h2-8H,1H3 |
Phytochemical cluster | No. 62 |
---|---|
KCF-S cluster | No. 41 |
By standard InChI | CHEMBL21745 |
---|---|
By standard InChI Main Layer | CHEMBL21745 |
By LinkDB | C10405 |
---|
By CAS RN | C073955 |
---|
class name | count |
---|---|
asterids | 5 |
rosids | 4 |
Euphyllophyta | 1 |
family name | count |
---|---|
Euphorbiaceae | 3 |
Bignoniaceae | 2 |
Lamiaceae | 1 |
Lygodiaceae | 1 |
Rutaceae | 1 |
Rubiaceae | 1 |
Verbenaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P08246 | Neutrophil elastase | S1A | CHEMBL21745 |
CHEMBL675351
(1)
|
2 / 1 |
P08311 | Cathepsin G | S1A | CHEMBL21745 |
CHEMBL661882
(1)
|
0 / 0 |