| id | C00002912 | 
|---|---|
| Name | Chebulinic acid | 
| CAS RN | 18942-26-2 | 
| Standard InChI | InChI=1S/C41H32O27/c42-15-1-10(2-16(43)26(15)51)35(56)62-9-22-31-33(66-36(57)11-3-17(44)27(52)18(45)4-11)34(41(63-22)68-37(58)12-5-19(46)28(53)20(47)6-12)67-38(59)13-7-21(48)29(54)32-25(13)24(30(55)40(61)65-32)14(8-23(49)50)39(60)64-31/h1-7,14,22,24,30-31,33-34,41-48,51-55H,8-9H2,(H,49,50)/t14-,22?,24-,30-,31+,33-,34?,41-/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C41H32O27/c42-15-1-10(2-16(43)26(15)51)35(56)62-9-22-31-33(66-36(57)11-3-17(44)27(52)18(45)4-11)34(41(63-22)68-37(58)12-5-19(46)28(53)20(47)6-12)67-38(59)13-7-21(48)29(54)32-25(13)24(30(55)40(61)65-32)14(8-23(49)50)39(60)64-31/h1-7,14,22,24,30-31,33-34,41-48,51-55H,8-9H2,(H,49,50) | 
| Phytochemical cluster | No. 81 | 
|---|---|
| KCF-S cluster | No. 226 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL501154 CHEMBL1159459 CHEMBL1391063 | 
| By LinkDB | C10215 | 
|---|
| By CAS RN | C103481 | 
|---|
| class name | count | 
|---|---|
| rosids | 3 | 
| family name | count | 
|---|---|
| Fabaceae | 1 | 
| Phyllanthaceae | 1 | 
| Combretaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Caesalpinia coriana | 53845 | Fabaceae | rosids | Viridiplantae | 
| Phyllanthus emblica | 296036 | Phyllanthaceae | rosids | Viridiplantae | 
| Terminalia chebula | 155022 | Combretaceae | rosids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | Other cytosolic protein | CHEMBL1391063 | CHEMBL1614529
                        (1) | 0 / 0 | 
| Q9UIF8 | Bromodomain adjacent to zinc finger domain protein 2B | Unclassified protein | CHEMBL1391063 | CHEMBL1738312
                        (1) | 0 / 0 | 
| P14618 | Pyruvate kinase PKM | Enzyme | CHEMBL1391063 | CHEMBL1613996
                        (1)
                        CHEMBL1614428
                        (1) | 0 / 0 | 
| P06746 | DNA polymerase beta | Enzyme | CHEMBL1391063 | CHEMBL1614079
                        (1) | 0 / 0 | 
| P10253 | Lysosomal alpha-glucosidase | Hydrolase | CHEMBL1391063 | CHEMBL1614175
                        (1)
                        CHEMBL1614076
                        (1) | 1 / 1 | 
| O75604 | Ubiquitin carboxyl-terminal hydrolase 2 | Enzyme | CHEMBL1391063 | CHEMBL1614474
                        (1) | 0 / 0 | 
| P10828 | Thyroid hormone receptor beta | NR1A2 | CHEMBL1391063 | CHEMBL1613776
                        (1) | 3 / 1 | 
| P54132 | Bloom syndrome protein | Enzyme | CHEMBL1391063 | CHEMBL1614067
                        (1) | 1 / 2 | 
| Q9NR56 | Muscleblind-like protein 1 | Unclassified protein | CHEMBL1391063 | CHEMBL1614166
                        (1) | 1 / 0 | 
| Q03164 | Histone-lysine N-methyltransferase 2A | Enzyme | CHEMBL1391063 | CHEMBL1614410
                        (1) | 1 / 3 | 
| P28482 | Mitogen-activated protein kinase 1 | Erk | CHEMBL1391063 | CHEMBL1614521
                        (1) | 0 / 0 | 
| P27695 | DNA-(apurinic or apyrimidinic site) lyase | Enzyme | CHEMBL1391063 | CHEMBL1614466
                        (1)
                        CHEMBL1614211
                        (1) | 0 / 0 | 
| P10636 | Microtubule-associated protein tau | Unclassified protein | CHEMBL1391063 | CHEMBL1614421
                        (1)
                        CHEMBL1614502
                        (1) | 4 / 3 | 
| B2RXH2 | Lysine-specific demethylase 4E | Enzyme | CHEMBL1391063 | CHEMBL1613914
                        (1) | 0 / 0 | 
| P46063 | ATP-dependent DNA helicase Q1 | Enzyme | CHEMBL1391063 | CHEMBL1613829
                        (1)
                        CHEMBL1613928
                        (1) | 0 / 0 | 
| Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 | Enzyme | CHEMBL1391063 | CHEMBL1614364
                        (1) | 1 / 1 | 
| Q13951 | Core-binding factor subunit beta | Unclassified protein | CHEMBL1391063 | CHEMBL1738090
                        (1)
                        CHEMBL1737904
                        (1) CHEMBL1738444 (1) | 0 / 1 | 
| Q01196 | Runt-related transcription factor 1 | Unclassified protein | CHEMBL1391063 | CHEMBL1738090
                        (1)
                        CHEMBL1737904
                        (1) CHEMBL1738444 (1) | 1 / 6 | 
| Q05513 | Protein kinase C zeta type | Iota | CHEMBL1159459 | CHEMBL769344
                        (1) | 0 / 0 | 
| Q04759 | Protein kinase C theta type | Delta | CHEMBL1159459 | CHEMBL769344
                        (1)
                        CHEMBL768505
                        (1) | 0 / 1 | 
| Q02156 | Protein kinase C epsilon type | Eta | CHEMBL1159459 | CHEMBL769344
                        (1)
                        CHEMBL768505
                        (1) | 0 / 0 | 
| O94806 | Serine/threonine-protein kinase D3 | Pkd | CHEMBL1159459 | CHEMBL769344
                        (1)
                        CHEMBL768505
                        (1) | 0 / 0 | 
| P17252 | Protein kinase C alpha type | Alpha | CHEMBL1159459 | CHEMBL769344
                        (1)
                        CHEMBL768505
                        (1) | 0 / 0 | 
| Q05655 | Protein kinase C delta type | Delta | CHEMBL1159459 | CHEMBL769344
                        (1)
                        CHEMBL768505
                        (1) | 0 / 0 | 
| P05129 | Protein kinase C gamma type | Alpha | CHEMBL1159459 | CHEMBL769344
                        (1)
                        CHEMBL768505
                        (1) | 1 / 1 | 
| P05771 | Protein kinase C beta type | Alpha | CHEMBL1159459 | CHEMBL769344
                        (1)
                        CHEMBL768505
                        (1) | 0 / 0 | 
| P24723 | Protein kinase C eta type | Eta | CHEMBL1159459 | CHEMBL769344
                        (1)
                        CHEMBL768505
                        (1) | 1 / 0 | 
| P41743 | Protein kinase C iota type | Iota | CHEMBL1159459 | CHEMBL769344
                        (1) | 0 / 0 | 
| Q15139 | Serine/threonine-protein kinase D1 | Pkd | CHEMBL1159459 | CHEMBL769344
                        (1)
                        CHEMBL768505
                        (1) | 0 / 0 | 
| compound | gene | gene name | gene description | interaction | interaction type | form | reference pmid | 
|---|---|---|---|---|---|---|---|
| C103481 | 43 | ACHE ACEE ARACHE N-ACHE YT | acetylcholinesterase (EC:3.1.1.7) | chebulinic acid results in decreased expression of ACHE protein | decreases expression | protein | 14769215 | 
| C103481 | 2623 | GATA1 ERYF1 GATA-1 GF-1 GF1 NF-E1 NFE1 XLANP XLTDA XLTT | GATA binding protein 1 (globin transcription factor 1) | chebulinic acid inhibits the reaction [Butyric Acid results in increased expression of GATA1 mRNA] | decreases reaction / increases expression | mRNA | 14769215 | 
| C103481 | 2623 | GATA1 ERYF1 GATA-1 GF-1 GF1 NF-E1 NFE1 XLANP XLTDA XLTT | GATA binding protein 1 (globin transcription factor 1) | chebulinic acid results in decreased expression of GATA1 mRNA | decreases expression | mRNA | 14769215 | 
| C103481 | 2624 | GATA2 DCML MONOMAC NFE1B | GATA binding protein 2 | chebulinic acid promotes the reaction [Butyric Acid results in increased expression of GATA2 mRNA] | increases expression / increases reaction | mRNA | 14769215 | 
| C103481 | 2624 | GATA2 DCML MONOMAC NFE1B | GATA binding protein 2 | chebulinic acid results in increased expression of GATA2 mRNA | increases expression | mRNA | 14769215 | 
| C103481 | 2993 | GYPA CD235a GPA GPErik GPSAT HGpMiV HGpMiXI HGpSta(C) MN MNS PAS-2 | glycophorin A (MNS blood group) | chebulinic acid inhibits the reaction [Tetradecanoylphorbol Acetate results in increased expression of GYPA protein] | decreases reaction / increases expression | protein | 14769215 | 
| C103481 | 3145 | HMBS PBG-D PBGD PORC UPS | hydroxymethylbilane synthase (EC:2.5.1.61) | chebulinic acid inhibits the reaction [Butyric Acid results in increased expression of HMBS mRNA] | decreases reaction / increases expression | mRNA | 14769215 | 
| C103481 | 3145 | HMBS PBG-D PBGD PORC UPS | hydroxymethylbilane synthase (EC:2.5.1.61) | chebulinic acid results in decreased expression of HMBS mRNA | decreases expression | mRNA | 14769215 | 
| C103481 | 4778 | NFE2 NF-E2 p45 | nuclear factor, erythroid 2 | chebulinic acid inhibits the reaction [Butyric Acid results in increased expression of NFE2 mRNA] | decreases reaction / increases expression | mRNA | 14769215 | 
| C103481 | 4778 | NFE2 NF-E2 p45 | nuclear factor, erythroid 2 | chebulinic acid results in decreased expression of NFE2 mRNA | decreases expression | mRNA | 14769215 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #210900 | Bloom syndrome; blm | P54132 | 
| #600274 | Frontotemporal dementia; ftd | P10636 | 
| #232300 | Glycogen storage disease ii | P10253 | 
| #605130 | Hairy elbows, short stature, facial dysmorphism, and developmental delay | Q03164 | 
| #160900 | Myotonic dystrophy 1; dm1 | Q9NR56 | 
| #260540 | Parkinson-dementia syndrome | P10636 | 
| #172700 | Pick disease of brain | P10636 | 
| #601399 | Platelet disorder, familial, with associated myeloid malignancy | Q01196 | 
| #605361 | Spinocerebellar ataxia 14; sca14 | P05129 | 
| #607250 | Spinocerebellar ataxia, autosomal recessive, with axonal neuropathy; scan1 | Q9NUW8 | 
| #601367 | Stroke, ischemic | P24723 | 
| #601104 | Supranuclear palsy, progressive, 1; psnp1 | P10636 | 
| #188570 | Thyroid hormone resistance, generalized, autosomal dominant; grth | P10828 | 
| #274300 | Thyroid hormone resistance, generalized, autosomal recessive; grth | P10828 | 
| #145650 | Thyroid hormone resistance, selective pituitary; prth | P10828 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00063 | Spinocerebellar ataxia (SCA) | P05129
                            (related) Q9NUW8 (related) | 
| H00069 | Glycogen storage diseases (GSD) | P10253
                            (related) | 
| H00058 | Amyotrophic lateral sclerosis (ALS) | P10636
                            (related) | 
| H00077 | Progressive supranuclear palsy (PSP) | P10636
                            (related) | 
| H00078 | Frontotemporal lobar degeneration (FTLD) | P10636
                            (related) | 
| H00249 | Thyroid hormone resistance syndrome | P10828
                            (related) | 
| H00094 | DNA repair defects | P54132
                            (related) | 
| H00296 | Defects in RecQ helicases | P54132
                            (related) | 
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) | Q01196
                            (related) Q01196 (marker) Q03164 (related) Q03164 (marker) | 
| H00003 | Acute myeloid leukemia (AML) | Q01196
                            (related) Q01196 (marker) Q13951 (marker) | 
| H00004 | Chronic myeloid leukemia (CML) | Q01196
                            (related) | 
| H00978 | Thrombocytopenia (THC) | Q01196
                            (related) | 
| H00002 | Acute lymphoblastic leukemia (ALL) (precursor T lymphoblastic leukemia) | Q03164
                            (related) | 
| H00408 | Type I diabetes mellitus | Q04759
                            (related) |