id | C00029476 |
---|---|
Name | Eudesmic acid / Trimethylgallic acid / 3,4,5-Trimethoxybenzoic acid |
CAS RN | 118-41-2 |
Standard InChI | InChI=1S/C10H12O5/c1-13-7-4-6(10(11)12)5-8(14-2)9(7)15-3/h4-5H,1-3H3,(H,11,12) |
Standard InChI (Main Layer) | InChI=1S/C10H12O5/c1-13-7-4-6(10(11)12)5-8(14-2)9(7)15-3/h4-5H,1-3H3,(H,11,12) |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 1073 |
By standard InChI | CHEMBL377172 |
---|---|
By standard InChI Main Layer | CHEMBL377172 |
By LinkDB |
---|
By CAS RN | C005854 |
---|
class name | count |
---|---|
rosids | 2 |
Magnoliophyta | 1 |
asterids | 1 |
family name | count |
---|---|
Juglandaceae | 1 |
Piperaceae | 1 |
Rubiaceae | 1 |
Begoniaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Begonia nantoensis | 78253 | Begoniaceae | rosids | Viridiplantae |
Engelhardia roxburghiana | 139932 | Juglandaceae | rosids | Viridiplantae |
Palicourea coriacea | 59595 | Rubiaceae | asterids | Viridiplantae |
Piper solmsianum | 538350 | Piperaceae | Magnoliophyta | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
O75496 | Geminin | Unclassified protein | CHEMBL377172 |
CHEMBL2114843
(1)
|
0 / 0 |
P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL377172 |
CHEMBL1794401
(1)
|
0 / 0 |
P51843 | Nuclear receptor subfamily 0 group B member 1 | Nuclear hormone receptor subfamily 0 group B member 1 | CHEMBL377172 |
CHEMBL1794556
(1)
|
2 / 2 |