| id | C00032087 |
|---|---|
| Name | Octadecanoic acid |
| CAS RN | 57-11-4 |
| Standard InChI | InChI=1S/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20) |
| Standard InChI (Main Layer) | InChI=1S/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20) |
| Phytochemical cluster | No. 68 |
|---|---|
| KCF-S cluster | No. 184 |
| By standard InChI | CHEMBL46403 |
|---|---|
| By standard InChI Main Layer | CHEMBL46403 |
| By LinkDB | C01530 |
|---|
| By CAS RN | C031183 |
|---|
| class name | count |
|---|---|
| rosids | 3 |
| Embryophyta | 2 |
| asterids | 1 |
| Magnoliophyta | 1 |
| family name | count |
|---|---|
| Frullaniaceae | 2 |
| Rosaceae | 1 |
| Piperaceae | 1 |
| Verbenaceae | 1 |
| Brassicaceae | 1 |
| Fabaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P15090 | Fatty acid-binding protein, adipocyte | Other cytosolic protein | CHEMBL46403 |
CHEMBL641280
(1)
|
0 / 0 |
| P16473 | Thyrotropin receptor | Glycohormone receptor | CHEMBL46403 |
CHEMBL1614281
(1)
CHEMBL1614361
(1)
|
3 / 2 |
| P10828 | Thyroid hormone receptor beta | NR1A2 | CHEMBL46403 |
CHEMBL1794399
(1)
|
3 / 1 |
| P11473 | Vitamin D3 receptor | NR1I1 | CHEMBL46403 |
CHEMBL1794339
(1)
|
2 / 3 |
| P04035 | 3-hydroxy-3-methylglutaryl-coenzyme A reductase | Oxidoreductase | CHEMBL46403 |
CHEMBL991179
(1)
|
0 / 0 |
| Q9UGP5 | DNA polymerase lambda | Enzyme | CHEMBL46403 |
CHEMBL1921596
(1)
CHEMBL1920071
(1)
|
0 / 0 |
| P04150 | Glucocorticoid receptor | NR3C1 | CHEMBL46403 |
CHEMBL1794456
(1)
|
0 / 1 |
| P11511 | Cytochrome P450 19A1 | Cytochrome P450 19A1 | CHEMBL46403 |
CHEMBL976708
(1)
|
2 / 2 |
| Q99714 | 3-hydroxyacyl-CoA dehydrogenase type-2 | Enzyme | CHEMBL46403 |
CHEMBL1613910
(1)
|
3 / 3 |
| P19838 | Nuclear factor NF-kappa-B p105 subunit | Transcription Factor | CHEMBL46403 |
CHEMBL2114853
(1)
|
0 / 0 |
| P16050 | Arachidonate 15-lipoxygenase | Enzyme | CHEMBL46403 |
CHEMBL1614240
(1)
|
0 / 0 |
| Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL46403 |
CHEMBL1921592
(1)
CHEMBL1921595
(1)
|
0 / 0 |
| Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 | Enzyme | CHEMBL46403 |
CHEMBL1614364
(1)
|
1 / 1 |
| O00255 | Menin | Unclassified protein | CHEMBL46403 |
CHEMBL1614531
(1)
|
2 / 5 |
| Q03164 | Histone-lysine N-methyltransferase 2A | Enzyme | CHEMBL46403 |
CHEMBL1614531
(1)
|
1 / 3 |
| compound | gene | gene name | gene description | interaction | interaction type | form |
reference
pmid |
|---|---|---|---|---|---|---|---|
| C031183 | 9619 |
ABCG1
ABC8 WHITE1 |
ATP-binding cassette, sub-family G (WHITE), member 1 | stearic acid results in increased expression of ABCG1 mRNA |
increases expression
|
mRNA |
16730733
|
| C031183 | 6348 |
CCL3
G0S19-1 LD78ALPHA MIP-1-alpha MIP1A SCYA3 |
chemokine (C-C motif) ligand 3 | stearic acid results in increased expression of CCL3 mRNA |
increases expression
|
mRNA |
21745629
|
| C031183 | 1906 |
EDN1
ET1 HDLCQ7 PPET1 |
endothelin 1 | stearic acid results in increased expression of EDN1 mRNA |
increases expression
|
mRNA |
16895544
|
| C031183 | 1906 |
EDN1
ET1 HDLCQ7 PPET1 |
endothelin 1 | stearic acid results in increased expression of EDN1 protein |
increases expression
|
protein |
16895544
|
| C031183 | 3576 |
IL8
CXCL8 GCP-1 GCP1 LECT LUCT LYNAP MDNCF MONAP NAF NAP-1 NAP1 |
interleukin 8 | stearic acid results in increased expression of IL8 mRNA |
increases expression
|
mRNA |
21745629
|
| C031183 | 5465 |
PPARA
NR1C1 PPAR PPARalpha hPPAR |
peroxisome proliferator-activated receptor alpha | stearic acid binds to and results in increased activity of PPARA protein |
affects binding
/ increases activity |
protein |
10403814
|
| C031183 | 10891 |
PPARGC1A
LEM6 PGC-1(alpha) PGC-1v PGC1 PGC1A PPARGC1 |
peroxisome proliferator-activated receptor gamma, coactivator 1 alpha | stearic acid results in increased expression of PPARGC1A mRNA |
increases expression
|
mRNA |
23056435
|
| OMIM | preferred title | UniProt |
|---|---|---|
| #300438 | 17-beta-hydroxysteroid dehydrogenase x deficiency |
Q99714
|
| #613546 | Aromatase deficiency |
P11511
|
| #139300 | Aromatase excess syndrome; aexs |
P11511
|
| #605130 | Hairy elbows, short stature, facial dysmorphism, and developmental delay |
Q03164
|
| #145000 | Hyperparathyroidism 1; hrpt1 |
O00255
|
| #603373 | Hyperthyroidism, familial gestational |
P16473
|
| #609152 | Hyperthyroidism, nonautoimmune |
P16473
|
| #275200 | Hypothyroidism, congenital, nongoitrous, 1; chng1 |
P16473
|
| #300705 | Mental retardation, x-linked 17; mrx17 |
Q99714
|
| #300220 | Mental retardation, x-linked, syndromic 10; mrxs10 |
Q99714
|
| #131100 | Multiple endocrine neoplasia, type i; men1 |
O00255
|
| #607948 | Mycobacterium tuberculosis, susceptibility to |
P11473
|
| #607250 | Spinocerebellar ataxia, autosomal recessive, with axonal neuropathy; scan1 |
Q9NUW8
|
| #188570 | Thyroid hormone resistance, generalized, autosomal dominant; grth |
P10828
|
| #274300 | Thyroid hormone resistance, generalized, autosomal recessive; grth |
P10828
|
| #145650 | Thyroid hormone resistance, selective pituitary; prth |
P10828
|
| #277440 | Vitamin d-dependent rickets, type 2a; vddr2a |
P11473
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00033 | Adrenal carcinoma |
O00255
(related)
|
| H00034 | Carcinoid |
O00255
(related)
|
| H00045 | Malignant islet cell carcinoma |
O00255
(related)
|
| H00246 | Primary hyperparathyroidism |
O00255
(related)
|
| H01102 | Pituitary adenomas |
O00255
(related)
|
| H00599 | 46,XX disorders of sex development (Disorders related to androgen excess) |
P04150
(related)
P11511 (related) |
| H00249 | Thyroid hormone resistance syndrome |
P10828
(related)
|
| H00342 | Tuberculosis |
P11473
(related)
|
| H00784 | Localized autosomal recessive hypotrichosis |
P11473
(related)
|
| H01143 | Vitamin D-dependent rickets |
P11473
(related)
|
| H00794 | Aromatase excess syndrome |
P11511
(related)
|
| H00250 | Congenital nongoitrous hypothyroidism (CHNG) |
P16473
(related)
|
| H01269 | Congenital hyperthyroidism |
P16473
(related)
|
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) |
Q03164
(related)
Q03164 (marker) |
| H00002 | Acute lymphoblastic leukemia (ALL) (precursor T lymphoblastic leukemia) |
Q03164
(related)
|
| H00480 | Non-syndromic X-linked mental retardation |
Q99714
(related)
|
| H00658 | Syndromic X-linked mental retardation |
Q99714
(related)
|
| H00925 | 2-Methyl-3-hydroxybutyryl-CoA dehydrogenase (MHBD) deficiency |
Q99714
(related)
|
| H00063 | Spinocerebellar ataxia (SCA) |
Q9NUW8
(related)
|