id | C00032471 |
---|---|
Name | Vanilloloside |
CAS RN | 74950-96-2 |
Standard InChI | InChI=1S/C14H20O8/c1-20-9-4-7(5-15)2-3-8(9)21-14-13(19)12(18)11(17)10(6-16)22-14/h2-4,10-19H,5-6H2,1H3/t10-,11-,12+,13-,14-/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C14H20O8/c1-20-9-4-7(5-15)2-3-8(9)21-14-13(19)12(18)11(17)10(6-16)22-14/h2-4,10-19H,5-6H2,1H3 |
Phytochemical cluster | No. 72 |
---|---|
KCF-S cluster | No. 45 |
By standard InChI | CHEMBL468568 |
---|---|
By standard InChI Main Layer | CHEMBL468568 |
By LinkDB |
---|
By CAS RN |
---|
family name | count |
---|---|
Capparaceae | 1 |
Hypericaceae | 1 |
Lamiaceae | 1 |
Bignoniaceae | 1 |
Loganiaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Capparis flavicans | 13394 | Capparaceae | rosids | Viridiplantae |
Hypericum erectum Thunb. | 282539 | Hypericaceae | rosids | Viridiplantae |
Scutellaria albida subsp.albida | 4139 | Lamiaceae | asterids | Viridiplantae |
Stereospermum cylindricum | 260324 | Bignoniaceae | asterids | Viridiplantae |
Strychnos axillaris | 1037789 | Loganiaceae | asterids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL468568 |
CHEMBL973285
(1)
|
0 / 3 |