id | C00034600 |
---|---|
Name | Methyl anthranilate |
CAS RN | 134-20-3 |
Standard InChI | InChI=1S/C8H9NO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,9H2,1H3 |
Standard InChI (Main Layer) | InChI=1S/C8H9NO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,9H2,1H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 4170 |
By standard InChI | CHEMBL1493986 |
---|---|
By standard InChI Main Layer | CHEMBL1493986 |
By LinkDB |
---|
By CAS RN | C038892 |
---|
class name | count |
---|---|
rosids | 9 |
family name | count |
---|---|
Rutaceae | 8 |
Brassicaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL1493986 |
CHEMBL1614458
(1)
|
0 / 0 |
Q99714 | 3-hydroxyacyl-CoA dehydrogenase type-2 | Enzyme | CHEMBL1493986 |
CHEMBL1613910
(1)
|
3 / 3 |
Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL1493986 |
CHEMBL2114890
(1)
|
0 / 0 |