| id | C00003867 |
|---|---|
| Name | Velutin / Flavoyadorigenin B / Luteolin 7,3'-dimethyl ether / 5-Hydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-4H-1-benzopyran-4-one |
| CAS RN | 25739-41-7 |
| Standard InChI | InChI=1S/C17H14O6/c1-21-10-6-12(19)17-13(20)8-14(23-16(17)7-10)9-3-4-11(18)15(5-9)22-2/h3-8,18-19H,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C17H14O6/c1-21-10-6-12(19)17-13(20)8-14(23-16(17)7-10)9-3-4-11(18)15(5-9)22-2/h3-8,18-19H,1-2H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 3 |
| By standard InChI | CHEMBL508292 |
|---|---|
| By standard InChI Main Layer | CHEMBL508292 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 26 |
| rosids | 7 |
| Liliopsida | 1 |
| Magnoliophyta | 1 |
| eudicotyledons | 1 |
| Embryophyta | 1 |
| family name | count |
|---|---|
| Asteraceae | 12 |
| Lamiaceae | 5 |
| Zygophyllaceae | 2 |
| Plantaginaceae | 2 |
| Hydrophyllaceae | 2 |
| Boraginaceae | 2 |
| Solanaceae | 2 |
| Malvaceae | 1 |
| Cunoniaceae | 1 |
| Verbenaceae | 1 |