id | C00003890 |
---|---|
Name | Jaceosidin / 5,7,4'-Trihydroxy-6,3'-dimethoxyflavone |
CAS RN | 18085-97-7 |
Standard InChI | InChI=1S/C17H14O7/c1-22-13-5-8(3-4-9(13)18)12-6-10(19)15-14(24-12)7-11(20)17(23-2)16(15)21/h3-7,18,20-21H,1-2H3 |
Standard InChI (Main Layer) | InChI=1S/C17H14O7/c1-22-13-5-8(3-4-9(13)18)12-6-10(19)15-14(24-12)7-11(20)17(23-2)16(15)21/h3-7,18,20-21H,1-2H3 |
Phytochemical cluster | No. 15 |
---|---|
KCF-S cluster | No. 3 |
By standard InChI | CHEMBL487601 |
---|---|
By standard InChI Main Layer | CHEMBL487601 |
By LinkDB |
---|
By CAS RN | C477508 |
---|
class name | count |
---|---|
asterids | 12 |
eudicotyledons | 1 |
rosids | 1 |
Liliopsida | 1 |
family name | count |
---|---|
Asteraceae | 7 |
Lamiaceae | 3 |
Plantaginaceae | 2 |
Bromeliaceae | 1 |
Rutaceae | 1 |
Amaranthaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P59538 | Taste receptor type 2 member 31 | Taste receptor (taste family GPCR) | CHEMBL487601 |
CHEMBL2039382
(1)
|
0 / 0 |