| id | C00003918 |
|---|---|
| Name | 5,7,3',4',5'-Pentamethoxyflavone / Tricetin 5,7,3',4',5'-pentamethyl ether / 5,7-Dimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-1-benzopyran-4-one |
| CAS RN | 53350-26-8 |
| Standard InChI | InChI=1S/C20H20O7/c1-22-12-8-15(23-2)19-13(21)10-14(27-16(19)9-12)11-6-17(24-3)20(26-5)18(7-11)25-4/h6-10H,1-5H3 |
| Standard InChI (Main Layer) | InChI=1S/C20H20O7/c1-22-12-8-15(23-2)19-13(21)10-14(27-16(19)9-12)11-6-17(24-3)20(26-5)18(7-11)25-4/h6-10H,1-5H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 8 |
| By standard InChI | CHEMBL2074901 |
|---|---|
| By standard InChI Main Layer | CHEMBL2074901 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Bauhinia championii | 228514 | Fabaceae | rosids | Viridiplantae |
| Ficus maxima | 100557 | Moraceae | rosids | Viridiplantae |
| Merrillia caloxylon | 159055 | Rutaceae | rosids | Viridiplantae |
| Murraya paniculata | 43711 | Rutaceae | rosids | Viridiplantae |
| Neoraputia paraensis | 23513 | Rutaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P08183 | Multidrug resistance protein 1 | drug | CHEMBL2074901 |
CHEMBL2077435
(1)
CHEMBL2076249
(1)
|
1 / 0 |