| id | C00000605 |
|---|---|
| Name | (+)-Secoisolariciresinol |
| CAS RN | 145265-02-7 |
| Standard InChI | InChI=1S/C20H26O6/c1-25-19-9-13(3-5-17(19)23)7-15(11-21)16(12-22)8-14-4-6-18(24)20(10-14)26-2/h3-6,9-10,15-16,21-24H,7-8,11-12H2,1-2H3/t15-,16-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C20H26O6/c1-25-19-9-13(3-5-17(19)23)7-15(11-21)16(12-22)8-14-4-6-18(24)20(10-14)26-2/h3-6,9-10,15-16,21-24H,7-8,11-12H2,1-2H3 |
| Phytochemical cluster | No. 21 |
|---|---|
| KCF-S cluster | No. 282 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL368347 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| rosids | 1 |
| Spermatophyta | 1 |
| family name | count |
|---|---|
| Asteraceae | 1 |
| Linaceae | 1 |
| Cupressaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Arctium lappa | 4217 | Asteraceae | asterids | Viridiplantae |
| Linum usitatissimum | 4006 | Linaceae | rosids | Viridiplantae |
| Thuja plicata | 3316 | Cupressaceae | Spermatophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL368347 |
CHEMBL1669910
(1)
|
1 / 0 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL368347 |
CHEMBL1669909
(1)
|
0 / 1 |