| id | C00006421 |
|---|---|
| Name | Neochamaejasmin B |
| CAS RN | 90411-12-4 |
| Standard InChI | InChI=1S/C30H22O10/c31-15-5-1-13(2-6-15)29-25(27(37)23-19(35)9-17(33)11-21(23)39-29)26-28(38)24-20(36)10-18(34)12-22(24)40-30(26)14-3-7-16(32)8-4-14/h1-12,25-26,29-36H/t25-,26-,29-,30?/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C30H22O10/c31-15-5-1-13(2-6-15)29-25(27(37)23-19(35)9-17(33)11-21(23)39-29)26-28(38)24-20(36)10-18(34)12-22(24)40-30(26)14-3-7-16(32)8-4-14/h1-12,25-26,29-36H |
| Phytochemical cluster | No. 18 |
|---|---|
| KCF-S cluster | No. 57 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL467196 CHEMBL452374 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 2 |
| family name | count |
|---|---|
| Thymelaeaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Stellera chamaejasme | 142738 | Thymelaeaceae | rosids | Viridiplantae |
| Wikstroemia sikokiana | 142693 | Thymelaeaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P05412 | Transcription factor AP-1 | Transcription Factor | CHEMBL452374 |
CHEMBL988801
(1)
|
0 / 0 |