id | C00007212 |
---|---|
Name | Galgravin |
CAS RN | 528-63-2 |
Standard InChI | InChI=1S/C22H28O5/c1-13-14(2)22(16-8-10-18(24-4)20(12-16)26-6)27-21(13)15-7-9-17(23-3)19(11-15)25-5/h7-14,21-22H,1-6H3/t13?,14?,21-,22+ |
Standard InChI (Main Layer) | InChI=1S/C22H28O5/c1-13-14(2)22(16-8-10-18(24-4)20(12-16)26-6)27-21(13)15-7-9-17(23-3)19(11-15)25-5/h7-14,21-22H,1-6H3 |
Phytochemical cluster | No. 21 |
---|---|
KCF-S cluster | No. 38 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL56800 CHEMBL57542 CHEMBL418309 CHEMBL291515 CHEMBL56856 CHEMBL56917 CHEMBL112481 CHEMBL469500 |
By LinkDB |
---|
By CAS RN | C084077 |
---|
class name | count |
---|---|
Magnoliophyta | 14 |
family name | count |
---|---|
Piperaceae | 6 |
Lauraceae | 3 |
Magnoliaceae | 2 |
Schisandraceae | 1 |
Himantandraceae | 1 |
Myristicaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P25105 | Platelet-activating factor receptor | PAF receptor | CHEMBL112481 |
CHEMBL882497
(1)
|
0 / 0 |