| id | C00000836 |
|---|---|
| Name | cis-Thujone / (+)-Thujone / beta-Thujone |
| CAS RN | 471-15-8 |
| Standard InChI | InChI=1S/C10H16O/c1-6(2)10-4-8(10)7(3)9(11)5-10/h6-8H,4-5H2,1-3H3/t7-,8+,10-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C10H16O/c1-6(2)10-4-8(10)7(3)9(11)5-10/h6-8H,4-5H2,1-3H3 |
| Phytochemical cluster | No. 35 |
|---|---|
| KCF-S cluster | No. 1161 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1444078 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Spermatophyta | 2 |
| asterids | 2 |
| eudicotyledons | 2 |
| rosids | 1 |
| family name | count |
|---|---|
| Cupressaceae | 1 |
| Asteraceae | 1 |
| Crassulaceae | 1 |
| Cistaceae | 1 |
| Pinaceae | 1 |
| Amaranthaceae | 1 |
| Lamiaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P16473 | Thyrotropin receptor | Glycohormone receptor | CHEMBL1444078 |
CHEMBL1614281
(1)
CHEMBL1614361
(1)
|
3 / 2 |
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL1444078 |
CHEMBL1794401
(1)
|
0 / 0 |