| id | C00008364 |
|---|---|
| Name | Norkurarinone / Sophoraflavanone G |
| CAS RN | 97938-30-2 |
| Standard InChI | InChI=1S/C25H28O6/c1-13(2)5-6-15(14(3)4)9-18-20(28)11-21(29)24-22(30)12-23(31-25(18)24)17-8-7-16(26)10-19(17)27/h5,7-8,10-11,15,23,26-29H,3,6,9,12H2,1-2,4H3 |
| Standard InChI (Main Layer) | InChI=1S/C25H28O6/c1-13(2)5-6-15(14(3)4)9-18-20(28)11-21(29)24-22(30)12-23(31-25(18)24)17-8-7-16(26)10-19(17)27/h5,7-8,10-11,15,23,26-29H,3,6,9,12H2,1-2,4H3 |
| Phytochemical cluster | No. 14 |
|---|---|
| KCF-S cluster | No. 19 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL243148 CHEMBL479477 |
| By LinkDB |
|---|
| By CAS RN | C064849 |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Sophora alopecuroides | 200492 | Fabaceae | rosids | Viridiplantae |
| Sophora davidii | 49839 | Fabaceae | rosids | Viridiplantae |
| Sophora flavescens | 49840 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P13866 | Sodium/glucose cotransporter 1 | Glucose | CHEMBL243148 |
CHEMBL892510
(1)
CHEMBL892512
(1)
|
1 / 1 |
| P31639 | Sodium/glucose cotransporter 2 | Glucose | CHEMBL243148 |
CHEMBL892511
(1)
CHEMBL892513
(1)
|
1 / 1 |
| P56817 | Beta-secretase 1 | A1A | CHEMBL243148 |
CHEMBL946247
(1)
CHEMBL946248
(1)
CHEMBL946249 (2) |
0 / 0 |