| id | C00008452 |
|---|---|
| Name | Euchrenone a7 / (2S)-Euchrenone a7 / (-)-(2S)-Euchrenone a7 |
| CAS RN | 130252-50-5 |
| Standard InChI | InChI=1S/C20H20O5/c1-11(2)3-5-14-16(22)8-7-15-18(24)10-19(25-20(14)15)13-6-4-12(21)9-17(13)23/h3-4,6-9,19,21-23H,5,10H2,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C20H20O5/c1-11(2)3-5-14-16(22)8-7-15-18(24)10-19(25-20(14)15)13-6-4-12(21)9-17(13)23/h3-4,6-9,19,21-23H,5,10H2,1-2H3 |
| Phytochemical cluster | No. 14 |
|---|---|
| KCF-S cluster | No. 28 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL457686 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Artocarpus communis | 194251 | Moraceae | rosids | Viridiplantae |
| Broussonetia papyrifera | 172644 | Moraceae | rosids | Viridiplantae |
| Euchresta horsfeldii | 53878 | Fabaceae | rosids | Viridiplantae |
| Sophora flavescens | 49840 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11511 | Cytochrome P450 19A1 | Cytochrome P450 19A1 | CHEMBL457686 |
CHEMBL949646
(1)
|
2 / 2 |