| id | C00000998 |
|---|---|
| Name | Prunin / Naringenin 7-O-beta-D-glucoside / 5,7,4'-Trihydroxyflavanone 7-O-beta-D-glucopyranoside |
| CAS RN | 529-55-5 |
| Standard InChI | InChI=1S/C21H22O10/c22-8-16-18(26)19(27)20(28)21(31-16)29-11-5-12(24)17-13(25)7-14(30-15(17)6-11)9-1-3-10(23)4-2-9/h1-6,14,16,18-24,26-28H,7-8H2/t14-,16?,18+,19-,20?,21+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C21H22O10/c22-8-16-18(26)19(27)20(28)21(31-16)29-11-5-12(24)17-13(25)7-14(30-15(17)6-11)9-1-3-10(23)4-2-9/h1-6,14,16,18-24,26-28H,7-8H2 |
| Phytochemical cluster | No. 14 |
|---|---|
| KCF-S cluster | No. 12 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL469654 CHEMBL526845 |
| By LinkDB | C09099 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 9 |
| Spermatophyta | 3 |
| eudicotyledons | 2 |
| asterids | 2 |
| Euphyllophyta | 1 |
| family name | count |
|---|---|
| Fabaceae | 4 |
| Viscaceae | 2 |
| Pinaceae | 2 |
| Plantaginaceae | 1 |
| Phyllanthaceae | 1 |
| Podocarpaceae | 1 |
| Rutaceae | 1 |
| Rosaceae | 1 |
| Coriariaceae | 1 |
| Dryopteridaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9UNQ0 | ATP-binding cassette sub-family G member 2 | ATP binding cassette | CHEMBL526845 |
CHEMBL2076243
(1)
CHEMBL2078552
(1)
|
2 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #614490 | Blood group, junior system; jr |
Q9UNQ0
|
| #138900 | Uric acid concentration, serum, quantitative trait locus 1; uaqtl1 |
Q9UNQ0
|