| id | C00000112 |
|---|---|
| Name | Indole-3-carboxaldehyde / 1H-Indole-3-carboxaldehyde |
| CAS RN | 487-89-8 |
| Standard InChI | InChI=1S/C9H7NO/c11-6-7-5-10-9-4-2-1-3-8(7)9/h1-6,10H |
| Standard InChI (Main Layer) | InChI=1S/C9H7NO/c11-6-7-5-10-9-4-2-1-3-8(7)9/h1-6,10H |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4314 |
| By standard InChI | CHEMBL147741 |
|---|---|
| By standard InChI Main Layer | CHEMBL147741 |
| By LinkDB | C08493 |
|---|
| By CAS RN | C012381 |
|---|
| class name | count |
|---|---|
| rosids | 11 |
| Liliopsida | 3 |
| Spermatophyta | 1 |
| asterids | 1 |
| family name | count |
|---|---|
| Rutaceae | 3 |
| Brassicaceae | 3 |
| Fabaceae | 2 |
| Malvaceae | 2 |
| Poaceae | 2 |
| Pinaceae | 1 |
| Streptomycetaceae | 1 |
| Dendrophylliidae | 1 |
| Chalinidae | 1 |
| Asteraceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P12268 | Inosine-5'-monophosphate dehydrogenase 2 | Oxidoreductase | CHEMBL147741 |
CHEMBL866259
(1)
|
0 / 0 |
| P00374 | Dihydrofolate reductase | Oxidoreductase | CHEMBL147741 |
CHEMBL1655374
(1)
|
1 / 1 |