id | C00000112 |
---|---|
Name | Indole-3-carboxaldehyde / 1H-Indole-3-carboxaldehyde |
CAS RN | 487-89-8 |
Standard InChI | InChI=1S/C9H7NO/c11-6-7-5-10-9-4-2-1-3-8(7)9/h1-6,10H |
Standard InChI (Main Layer) | InChI=1S/C9H7NO/c11-6-7-5-10-9-4-2-1-3-8(7)9/h1-6,10H |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 4314 |
By standard InChI | CHEMBL147741 |
---|---|
By standard InChI Main Layer | CHEMBL147741 |
By LinkDB | C08493 |
---|
By CAS RN | C012381 |
---|
class name | count |
---|---|
rosids | 11 |
Liliopsida | 3 |
Spermatophyta | 1 |
asterids | 1 |
family name | count |
---|---|
Rutaceae | 3 |
Brassicaceae | 3 |
Fabaceae | 2 |
Malvaceae | 2 |
Poaceae | 2 |
Pinaceae | 1 |
Streptomycetaceae | 1 |
Dendrophylliidae | 1 |
Chalinidae | 1 |
Asteraceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P12268 | Inosine-5'-monophosphate dehydrogenase 2 | Oxidoreductase | CHEMBL147741 |
CHEMBL866259
(1)
|
0 / 0 |
P00374 | Dihydrofolate reductase | Oxidoreductase | CHEMBL147741 |
CHEMBL1655374
(1)
|
1 / 1 |