id | C00001555 |
---|---|
Name | Trigonelline |
CAS RN | 535-83-1 |
Standard InChI | InChI=1S/C7H7NO2/c1-8-4-2-3-6(5-8)7(9)10/h2-5H,1H3 |
Standard InChI (Main Layer) | InChI=1S/C7H7NO2/c1-8-4-2-3-6(5-8)7(9)10/h2-5H,1H3 |
Phytochemical cluster | No. 1 |
---|---|
KCF-S cluster | No. 3681 |
By standard InChI | CHEMBL350675 |
---|---|
By standard InChI Main Layer | CHEMBL350675 |
By LinkDB | C01004 |
---|
By CAS RN | C009560 |
---|
class name | count |
---|---|
rosids | 19 |
asterids | 3 |
Spermatophyta | 1 |
family name | count |
---|---|
Fabaceae | 18 |
Rubiaceae | 1 |
Gnetaceae | 1 |
Styelidae | 1 |
Apocynaceae | 1 |
Asteraceae | 1 |
Cannabaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
O75604 | Ubiquitin carboxyl-terminal hydrolase 2 | Enzyme | CHEMBL350675 |
CHEMBL1614331
(1)
|
0 / 0 |
P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL350675 |
CHEMBL1794401
(1)
|
0 / 0 |
O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | Enzyme | CHEMBL350675 |
CHEMBL2354311
(1)
|
1 / 0 |