| id | C00002920 |
|---|---|
| Name | Eugeniin |
| CAS RN | 58970-75-5 |
| Standard InChI | InChI=1S/C41H30O26/c42-15-1-10(2-16(43)26(15)50)36(57)65-34-33-23(9-62-39(60)13-7-21(48)29(53)31(55)24(13)25-14(40(61)64-33)8-22(49)30(54)32(25)56)63-41(67-38(59)12-5-19(46)28(52)20(47)6-12)35(34)66-37(58)11-3-17(44)27(51)18(45)4-11/h1-8,23,33-35,41-56H,9H2/t23?,33-,34+,35?,41+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C41H30O26/c42-15-1-10(2-16(43)26(15)50)36(57)65-34-33-23(9-62-39(60)13-7-21(48)29(53)31(55)24(13)25-14(40(61)64-33)8-22(49)30(54)32(25)56)63-41(67-38(59)12-5-19(46)28(52)20(47)6-12)35(34)66-37(58)11-3-17(44)27(51)18(45)4-11/h1-8,23,33-35,41-56H,9H2 |
| Phytochemical cluster | No. 81 |
|---|---|
| KCF-S cluster | No. 302 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL450745 CHEMBL510512 |
| By LinkDB | C10224 |
|---|
| By CAS RN | C110634 |
|---|
| class name | count |
|---|---|
| rosids | 5 |
| asterids | 1 |
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Coriariaceae | 1 |
| Cornaceae | 1 |
| Onagraceae | 1 |
| Fagaceae | 1 |
| Rosaceae | 1 |
| Myrtaceae | 1 |
| Saxifragaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Coriaria japonica | 79757 | Coriariaceae | rosids | Viridiplantae |
| Cornus spp. | 4281 | Cornaceae | asterids | Viridiplantae |
| Fuchsia spp. | 13069 | Onagraceae | rosids | Viridiplantae |
| Quercus spp. | 3511 | Fagaceae | rosids | Viridiplantae |
| Rosa spp. | 3764 | Rosaceae | rosids | Viridiplantae |
| Syzygium aromaticum | 219868 | Myrtaceae | rosids | Viridiplantae |
| Tellima grandiflora | 29775 | Saxifragaceae | eudicotyledons | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P00742 | Coagulation factor X | S1A | CHEMBL510512 |
CHEMBL1007649
(1)
CHEMBL1007650
(1)
|
1 / 0 |