id | C00029536 |
---|---|
Name | p-Anisic acid / 4-Methoxybenzoic acid |
CAS RN | 100-09-4 |
Standard InChI | InChI=1S/C8H8O3/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3,(H,9,10) |
Standard InChI (Main Layer) | InChI=1S/C8H8O3/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3,(H,9,10) |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 2930 |
By standard InChI | CHEMBL21932 |
---|---|
By standard InChI Main Layer | CHEMBL21932 |
By LinkDB | C02519 |
---|
By CAS RN | C004520 |
---|
class name | count |
---|---|
asterids | 4 |
Magnoliophyta | 3 |
rosids | 2 |
Liliopsida | 1 |
eudicotyledons | 1 |
family name | count |
---|---|
Asteraceae | 2 |
Styelidae | 1 |
Piperaceae | 1 |
Posidoniaceae | 1 |
Lauraceae | 1 |
Euphorbiaceae | 1 |
Annonaceae | 1 |
Aizoaceae | 1 |
Malvaceae | 1 |
Rubiaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P00918 | Carbonic anhydrase 2 | Lyase | CHEMBL21932 |
CHEMBL1762939
(1)
|
1 / 2 |
P00915 | Carbonic anhydrase 1 | Lyase | CHEMBL21932 |
CHEMBL1762938
(1)
|
0 / 0 |
P51580 | Thiopurine S-methyltransferase | Enzyme | CHEMBL21932 |
CHEMBL814140
(1)
|
1 / 1 |