| id | C00029819 |
|---|---|
| Name | beta-Mangostin |
| CAS RN | 20931-37-7 |
| Standard InChI | InChI=1S/C25H28O6/c1-13(2)7-9-15-18(29-5)12-20-22(23(15)27)24(28)21-16(10-8-14(3)4)25(30-6)17(26)11-19(21)31-20/h7-8,11-12,26-27H,9-10H2,1-6H3 |
| Standard InChI (Main Layer) | InChI=1S/C25H28O6/c1-13(2)7-9-15-18(29-5)12-20-22(23(15)27)24(28)21-16(10-8-14(3)4)25(30-6)17(26)11-19(21)31-20/h7-8,11-12,26-27H,9-10H2,1-6H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 14 |
| By standard InChI | CHEMBL261706 |
|---|---|
| By standard InChI Main Layer | CHEMBL261706 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 5 |
| family name | count |
|---|---|
| Clusiaceae | 4 |
| Hypericaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Cratoxylum cochinchinense | 271749 | Hypericaceae | rosids | Viridiplantae |
| Garcinia cowa | 180103 | Clusiaceae | rosids | Viridiplantae |
| Garcinia dulcis | 231905 | Clusiaceae | rosids | Viridiplantae |
| Garcinia fusca | 58227 | Clusiaceae | rosids | Viridiplantae |
| Garcinia mangostana | 58228 | Clusiaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P49327 | Fatty acid synthase | Transferase | CHEMBL261706 |
CHEMBL1260142
(1)
|
0 / 0 |
| Q04206 | Transcription factor p65 | Transcription Factor | CHEMBL261706 |
CHEMBL1100043
(1)
|
0 / 0 |
| P19838 | Nuclear factor NF-kappa-B p105 subunit | Transcription Factor | CHEMBL261706 |
CHEMBL1100041
(1)
|
0 / 0 |