| id | C00003800 |
|---|---|
| Name | 7,4'-Dihydroxyflavone |
| CAS RN | 2196-14-7 |
| Standard InChI | InChI=1S/C15H10O4/c16-10-3-1-9(2-4-10)14-8-13(18)12-6-5-11(17)7-15(12)19-14/h1-8,16-17H |
| Standard InChI (Main Layer) | InChI=1S/C15H10O4/c16-10-3-1-9(2-4-10)14-8-13(18)12-6-5-11(17)7-15(12)19-14/h1-8,16-17H |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 76 |
| By standard InChI | CHEMBL294878 |
|---|---|
| By standard InChI Main Layer | CHEMBL294878 |
| By LinkDB | C12123 |
|---|
| By CAS RN | C085172 |
|---|
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q16637 | Survival motor neuron protein | Unclassified protein | CHEMBL294878 |
CHEMBL1613842
(1)
|
4 / 2 |
| Q03181 | Peroxisome proliferator-activated receptor delta | NR1C2 | CHEMBL294878 |
CHEMBL2341203
(1)
CHEMBL2341207
(1)
|
0 / 0 |
| P05091 | Aldehyde dehydrogenase, mitochondrial | Oxidoreductase | CHEMBL294878 |
CHEMBL641142
(1)
|
1 / 1 |
| Q9Y3R4 | Sialidase-2 | Enzyme | CHEMBL294878 |
CHEMBL1100507
(1)
|
0 / 0 |
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL294878 |
CHEMBL1614458
(1)
|
0 / 0 |
| P11511 | Cytochrome P450 19A1 | Cytochrome P450 19A1 | CHEMBL294878 |
CHEMBL1105634
(1)
|
2 / 2 |
| P37231 | Peroxisome proliferator-activated receptor gamma | NR1C3 | CHEMBL294878 |
CHEMBL1059360
(1)
CHEMBL1059361
(1)
|
5 / 3 |
| P06280 | Alpha-galactosidase A | Enzyme | CHEMBL294878 |
CHEMBL1614369
(1)
|
1 / 1 |
| P28482 | Mitogen-activated protein kinase 1 | Erk | CHEMBL294878 |
CHEMBL1613808
(1)
|
0 / 0 |
| Q99714 | 3-hydroxyacyl-CoA dehydrogenase type-2 | Enzyme | CHEMBL294878 |
CHEMBL1613910
(1)
|
3 / 3 |
| P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD(+)] | Enzyme | CHEMBL294878 |
CHEMBL1614038
(1)
|
2 / 2 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL294878 |
CHEMBL1614108
(1)
CHEMBL1613886
(1)
|
0 / 1 |
| Q07869 | Peroxisome proliferator-activated receptor alpha | NR1C1 | CHEMBL294878 |
CHEMBL1059364
(1)
CHEMBL1059365
(1)
|
0 / 0 |
| P06239 | Tyrosine-protein kinase Lck | Src | CHEMBL294878 |
CHEMBL941407
(1)
|
0 / 1 |
| B2RXH2 | Lysine-specific demethylase 4E | Enzyme | CHEMBL294878 |
CHEMBL1613914
(1)
|
0 / 0 |
| P27338 | Amine oxidase [flavin-containing] B | Oxidoreductase | CHEMBL294878 |
CHEMBL731145
(1)
|
0 / 0 |
| P21397 | Amine oxidase [flavin-containing] A | Oxidoreductase | CHEMBL294878 |
CHEMBL731145
(1)
|
1 / 1 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #300438 | 17-beta-hydroxysteroid dehydrogenase x deficiency |
Q99714
|
| #610251 | Alcohol sensitivity, acute |
P05091
|
| #613546 | Aromatase deficiency |
P11511
|
| #139300 | Aromatase excess syndrome; aexs |
P11511
|
| %606641 | Body mass index; bmi |
P37231
|
| #300615 | Brunner syndrome |
P21397
|
| #609338 | Carotid intimal medial thickness 1 |
P37231
|
| #119900 | Digital clubbing, isolated congenital |
P15428
|
| #301500 | Fabry disease |
P06280
|
| #137800 | Glioma susceptibility 1; glm1 |
P37231
|
| #259100 | Hypertrophic osteoarthropathy, primary, autosomal recessive, 1; phoar1 |
P15428
|
| #604367 | Lipodystrophy, familial partial, type 3; fpld3 |
P37231
|
| #300705 | Mental retardation, x-linked 17; mrx17 |
Q99714
|
| #300220 | Mental retardation, x-linked, syndromic 10; mrxs10 |
Q99714
|
| #601665 | Obesity |
P37231
|
| #253300 | Spinal muscular atrophy, type i; sma1 |
Q16637
|
| #253550 | Spinal muscular atrophy, type ii; sma2 |
Q16637
|
| #253400 | Spinal muscular atrophy, type iii; sma3 |
Q16637
|
| #271150 | Spinal muscular atrophy, type iv; sma4 |
Q16637
|
| KEGG | disease name | UniProt |
|---|---|---|
| H01071 | Acute alcohol sensitivity |
P05091
(related)
|
| H00093 | Combined immunodeficiencies (CIDs) |
P06239
(related)
|
| H00125 | Fabry disease |
P06280
(related)
|
| H00036 | Osteosarcoma |
P08684
(marker)
|
| H00599 | 46,XX disorders of sex development (Disorders related to androgen excess) |
P11511
(related)
|
| H00794 | Aromatase excess syndrome |
P11511
(related)
|
| H00457 | Primary hypertrophic osteoarthropathy (PHO) |
P15428
(related)
|
| H01246 | Isolated congenital nail clubbing (ICNC) |
P15428
(related)
|
| H00548 | Brunner syndrome |
P21397
(related)
|
| H00032 | Thyroid cancer |
P37231
(related)
|
| H00409 | Type II diabetes mellitus |
P37231
(related)
|
| H00420 | Familial partial lipodystrophy (FPL) |
P37231
(related)
|
| H00455 | Spinal muscular atrophy (SMA) |
Q16637
(related)
Q16637 (related) |
| H00480 | Non-syndromic X-linked mental retardation |
Q99714
(related)
|
| H00658 | Syndromic X-linked mental retardation |
Q99714
(related)
|
| H00925 | 2-Methyl-3-hydroxybutyryl-CoA dehydrogenase (MHBD) deficiency |
Q99714
(related)
|