| id | C00005367 |
|---|---|
| Name | Avicularin / Avicularine / Avicularoside / Quercetin 3-alpha-L-arabinofuranoside / Quercetin 3-O-alpha-L-arabinofuranoside |
| CAS RN | 572-30-5 |
| Standard InChI | InChI=1S/C20H18O11/c21-6-13-15(26)17(28)20(30-13)31-19-16(27)14-11(25)4-8(22)5-12(14)29-18(19)7-1-2-9(23)10(24)3-7/h1-5,13,15,17,20-26,28H,6H2/t13-,15+,17?,20-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C20H18O11/c21-6-13-15(26)17(28)20(30-13)31-19-16(27)14-11(25)4-8(22)5-12(14)29-18(19)7-1-2-9(23)10(24)3-7/h1-5,13,15,17,20-26,28H,6H2 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 2 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL471282 CHEMBL1590676 |
| By LinkDB |
|---|
| By CAS RN | C041388 |
|---|
| class name | count |
|---|---|
| rosids | 7 |
| asterids | 6 |
| Spermatophyta | 1 |
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Ericaceae | 5 |
| Rosaceae | 3 |
| Myrtaceae | 2 |
| Juglandaceae | 1 |
| Hypericaceae | 1 |
| Solanaceae | 1 |
| Polygonaceae | 1 |
| Cupressaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P39748 | Flap endonuclease 1 | Enzyme | CHEMBL1590676 |
CHEMBL1794486
(1)
|
0 / 0 |
| O75496 | Geminin | Unclassified protein | CHEMBL1590676 |
CHEMBL2114843
(1)
CHEMBL2114780
(1)
|
0 / 0 |
| P15121 | Aldose reductase | Enzyme | CHEMBL471282 |
CHEMBL1942674
(1)
|
0 / 0 |
| Q9Y253 | DNA polymerase eta | Enzyme | CHEMBL1590676 |
CHEMBL1794569
(1)
|
1 / 1 |
| Q9Y468 | Lethal(3)malignant brain tumor-like protein 1 | Unclassified protein | CHEMBL1590676 |
CHEMBL1614280
(1)
|
0 / 0 |
| P11308 | Transcriptional regulator ERG | Unclassified protein | CHEMBL1590676 |
CHEMBL2114924
(1)
|
1 / 2 |
| Q96QE3 | ATPase family AAA domain-containing protein 5 | Unclassified protein | CHEMBL1590676 |
CHEMBL1738588
(1)
|
0 / 0 |
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL1590676 |
CHEMBL1794483
(1)
|
0 / 0 |
| Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL1590676 |
CHEMBL1794536
(1)
|
0 / 0 |
| O94925 | Glutaminase kidney isoform, mitochondrial | Enzyme | CHEMBL1590676 |
CHEMBL2114738
(1)
|
0 / 0 |