id | C00005851 |
---|---|
Name | Tiliroside / Potengriffioside A / Kaempferol 3-O-beta-D-(6''-coumaroyl)-glucopyranoside |
CAS RN | 20316-62-5 |
Standard InChI | InChI=1S/C30H26O13/c31-16-6-1-14(2-7-16)3-10-22(35)40-13-21-24(36)26(38)27(39)30(42-21)43-29-25(37)23-19(34)11-18(33)12-20(23)41-28(29)15-4-8-17(32)9-5-15/h1-12,21,24,26-27,30-34,36,38-39H,13H2/b10-3+/t21-,24-,26?,27?,30+/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C30H26O13/c31-16-6-1-14(2-7-16)3-10-22(35)40-13-21-24(36)26(38)27(39)30(42-21)43-29-25(37)23-19(34)11-18(33)12-20(23)41-28(29)15-4-8-17(32)9-5-15/h1-12,21,24,26-27,30-34,36,38-39H,13H2 |
Phytochemical cluster | No. 15 |
---|---|
KCF-S cluster | No. 30 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL266564 CHEMBL499705 |
By LinkDB |
---|
By CAS RN | C052083 |
---|
class name | count |
---|---|
rosids | 10 |
eudicotyledons | 2 |
asterids | 2 |
Spermatophyta | 2 |
Magnoliophyta | 1 |
Euphyllophyta | 1 |
family name | count |
---|---|
Malvaceae | 3 |
Pinaceae | 2 |
Fagaceae | 2 |
Rosaceae | 2 |
Lauraceae | 1 |
Cistaceae | 1 |
Amaranthaceae | 1 |
Platanaceae | 1 |
Melastomataceae | 1 |
Dennstaedtiaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P47989 | Xanthine dehydrogenase/oxidase | Oxidoreductase | CHEMBL266564 |
CHEMBL1023248
(1)
|
1 / 1 |
P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL266564 CHEMBL499705 |
CHEMBL999263
(2)
|
0 / 1 |