| id | C00006933 |
|---|---|
| Name | 2',4',6'-Trihydroxychalcone |
| CAS RN | 4197-97-1 |
| Standard InChI | InChI=1S/C15H12O4/c16-11-8-13(18)15(14(19)9-11)12(17)7-6-10-4-2-1-3-5-10/h1-9,16,18-19H/b7-6+ |
| Standard InChI (Main Layer) | InChI=1S/C15H12O4/c16-11-8-13(18)15(14(19)9-11)12(17)7-6-10-4-2-1-3-5-10/h1-9,16,18-19H |
| Phytochemical cluster | No. 13 |
|---|---|
| KCF-S cluster | No. 92 |
| By standard InChI | CHEMBL129371 |
|---|---|
| By standard InChI Main Layer | CHEMBL129371 |
| By LinkDB | C16404 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 6 |
| rosids | 3 |
| Euphyllophyta | 1 |
| family name | count |
|---|---|
| Asteraceae | 6 |
| Salicaceae | 3 |
| Pteridaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL129371 |
CHEMBL763074
(1)
|
0 / 0 |
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL129371 |
CHEMBL763074
(1)
|
0 / 3 |