| id | C00000723 |
|---|---|
| Name | Liriodendrin / Acanthoside D / (+)-Syringaresinol di-O-beta-glucopyranoside |
| CAS RN | 573-44-4 |
| Standard InChI | InChI=1S/C34H46O18/c1-43-17-5-13(6-18(44-2)31(17)51-33-27(41)25(39)23(37)21(9-35)49-33)29-15-11-48-30(16(15)12-47-29)14-7-19(45-3)32(20(8-14)46-4)52-34-28(42)26(40)24(38)22(10-36)50-34/h5-8,15-16,21-30,33-42H,9-12H2,1-4H3/t15-,16-,21?,22?,23+,24+,25-,26-,27?,28?,29+,30+,33-,34-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C34H46O18/c1-43-17-5-13(6-18(44-2)31(17)51-33-27(41)25(39)23(37)21(9-35)49-33)29-15-11-48-30(16(15)12-47-29)14-7-19(45-3)32(20(8-14)46-4)52-34-28(42)26(40)24(38)22(10-36)50-34/h5-8,15-16,21-30,33-42H,9-12H2,1-4H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 152 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL446836 CHEMBL505393 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 8 |
| rosids | 3 |
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Plantaginaceae | 2 |
| Oleaceae | 2 |
| Phyllanthaceae | 1 |
| Eucommiaceae | 1 |
| Bignoniaceae | 1 |
| Araliaceae | 1 |
| Rosaceae | 1 |
| Thymelaeaceae | 1 |
| Lardizabalaceae | 1 |
| Loganiaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P17405 | Sphingomyelin phosphodiesterase | Enzyme | CHEMBL505393 |
CHEMBL1794495
(1)
|
2 / 2 |
| O75496 | Geminin | Unclassified protein | CHEMBL505393 |
CHEMBL2114780
(1)
|
0 / 0 |