id | C00001186 |
---|---|
Name | Glyoxylic acid |
CAS RN | 298-12-4 |
Standard InChI | InChI=1S/C2H2O3/c3-1-2(4)5/h1H,(H,4,5) |
Standard InChI (Main Layer) | InChI=1S/C2H2O3/c3-1-2(4)5/h1H,(H,4,5) |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 7855 |
By standard InChI | CHEMBL1162545 |
---|---|
By standard InChI Main Layer | CHEMBL1162545 |
By LinkDB | C00048 |
---|
By CAS RN | C031150 |
---|
class name | count |
---|---|
rosids | 5 |
family name | count |
---|---|
Fabaceae | 3 |
Enterobacteriaceae | 1 |
Aspergillaceae | 1 |
Brassicaceae | 1 |
Pseudomonadaceae | 1 |
Euphorbiaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
O15427 | Monocarboxylate transporter 4 | Unclassified protein | CHEMBL1162545 |
CHEMBL2076227
(1)
|
0 / 0 |