| id | C00002177 |
|---|---|
| Name | Kokusaginine |
| CAS RN | 484-08-2 |
| Standard InChI | InChI=1S/C14H13NO4/c1-16-11-6-9-10(7-12(11)17-2)15-14-8(4-5-19-14)13(9)18-3/h4-7H,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C14H13NO4/c1-16-11-6-9-10(7-12(11)17-2)15-14-8(4-5-19-14)13(9)18-3/h4-7H,1-3H3 |
| Phytochemical cluster | No. 7 |
|---|---|
| KCF-S cluster | No. 368 |
| By standard InChI | CHEMBL278779 |
|---|---|
| By standard InChI Main Layer | CHEMBL278779 |
| By LinkDB | C10701 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 12 |
| family name | count |
|---|---|
| Rutaceae | 12 |
| Notodontidae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9UIF8 | Bromodomain adjacent to zinc finger domain protein 2B | Unclassified protein | CHEMBL278779 |
CHEMBL1738312
(1)
|
0 / 0 |
| P37840 | Alpha-synuclein | Unclassified protein | CHEMBL278779 |
CHEMBL2354282
(1)
|
4 / 2 |
| P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL278779 |
CHEMBL1794584
(1)
|
2 / 0 |
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL278779 |
CHEMBL2114788
(1)
|
0 / 0 |
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL278779 |
CHEMBL1794401
(1)
|
0 / 0 |
| P27695 | DNA-(apurinic or apyrimidinic site) lyase | Enzyme | CHEMBL278779 |
CHEMBL1614211
(1)
|
0 / 0 |
| Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL278779 |
CHEMBL1738184
(1)
|
0 / 0 |
| B2RXH2 | Lysine-specific demethylase 4E | Enzyme | CHEMBL278779 |
CHEMBL1613914
(1)
|
0 / 0 |
| Q13148 | TAR DNA-binding protein 43 | Unclassified protein | CHEMBL278779 |
CHEMBL2354287
(1)
|
1 / 1 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #612069 | Amyotrophic lateral sclerosis 10, with or without frontotemporal dementia; als10 |
Q13148
|
| #114500 | Colorectal cancer; crc |
P84022
|
| #127750 | Dementia, lewy body; dlb |
P37840
|
| #613795 | Loeys-dietz syndrome, type 3; lds3 |
P84022
|
| #168601 | Parkinson disease 1, autosomal dominant; park1 |
P37840
|
| #605543 | Parkinson disease 4, autosomal dominant; park4 |
P37840
|
| #168600 | Parkinson disease, late-onset; pd |
P37840
|