id | C00002376 |
---|---|
Name | Cyanidin 3-rutinoside |
CAS RN | 18719-76-1 |
Standard InChI | InChI=1S/C27H30O15/c1-9-19(32)21(34)23(36)26(39-9)38-8-18-20(33)22(35)24(37)27(42-18)41-17-7-12-14(30)5-11(28)6-16(12)40-25(17)10-2-3-13(29)15(31)4-10/h2-7,9,18-24,26-27,32-37H,8H2,1H3,(H3-,28,29,30,31)/p+1/t9?,18?,19-,20+,21-,22?,23?,24?,26+,27+/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C27H30O15/c1-9-19(32)21(34)23(36)26(39-9)38-8-18-20(33)22(35)24(37)27(42-18)41-17-7-12-14(30)5-11(28)6-16(12)40-25(17)10-2-3-13(29)15(31)4-10/h2-7,9,18-24,26-27,32-37H,8H2,1H3,(H3-,28,29,30,31) |
Phytochemical cluster | No. 15 |
---|---|
KCF-S cluster | No. 1 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL505251 |
By LinkDB | C04491 |
---|
By CAS RN | C020386 |
---|
class name | count |
---|---|
Liliopsida | 31 |
rosids | 12 |
asterids | 9 |
Magnoliophyta | 2 |
eudicotyledons | 2 |
family name | count |
---|---|
Poaceae | 19 |
Rosaceae | 4 |
Aceraceae | 3 |
Liliaceae | 2 |
Musaceae | 2 |
Araceae | 2 |
Polygonaceae | 2 |
Bignoniaceae | 2 |
Euphorbiaceae | 2 |
Arecaceae | 2 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
Q07812 | Apoptosis regulator BAX | Unclassified protein | CHEMBL505251 |
CHEMBL1007222
(1)
|
0 / 1 |
Q16611 | Bcl-2 homologous antagonist/killer | Unclassified protein | CHEMBL505251 |
CHEMBL1007221
(1)
|
0 / 0 |
O43521 | Bcl-2-like protein 11 | Unclassified protein | CHEMBL505251 |
CHEMBL1007223
(1)
|
0 / 0 |