| id | C00002376 |
|---|---|
| Name | Cyanidin 3-rutinoside |
| CAS RN | 18719-76-1 |
| Standard InChI | InChI=1S/C27H30O15/c1-9-19(32)21(34)23(36)26(39-9)38-8-18-20(33)22(35)24(37)27(42-18)41-17-7-12-14(30)5-11(28)6-16(12)40-25(17)10-2-3-13(29)15(31)4-10/h2-7,9,18-24,26-27,32-37H,8H2,1H3,(H3-,28,29,30,31)/p+1/t9?,18?,19-,20+,21-,22?,23?,24?,26+,27+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C27H30O15/c1-9-19(32)21(34)23(36)26(39-9)38-8-18-20(33)22(35)24(37)27(42-18)41-17-7-12-14(30)5-11(28)6-16(12)40-25(17)10-2-3-13(29)15(31)4-10/h2-7,9,18-24,26-27,32-37H,8H2,1H3,(H3-,28,29,30,31) |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 1 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL505251 |
| By LinkDB | C04491 |
|---|
| By CAS RN | C020386 |
|---|
| class name | count |
|---|---|
| Liliopsida | 31 |
| rosids | 12 |
| asterids | 9 |
| Magnoliophyta | 2 |
| eudicotyledons | 2 |
| family name | count |
|---|---|
| Poaceae | 19 |
| Rosaceae | 4 |
| Aceraceae | 3 |
| Liliaceae | 2 |
| Musaceae | 2 |
| Araceae | 2 |
| Polygonaceae | 2 |
| Bignoniaceae | 2 |
| Euphorbiaceae | 2 |
| Arecaceae | 2 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q07812 | Apoptosis regulator BAX | Unclassified protein | CHEMBL505251 |
CHEMBL1007222
(1)
|
0 / 1 |
| Q16611 | Bcl-2 homologous antagonist/killer | Unclassified protein | CHEMBL505251 |
CHEMBL1007221
(1)
|
0 / 0 |
| O43521 | Bcl-2-like protein 11 | Unclassified protein | CHEMBL505251 |
CHEMBL1007223
(1)
|
0 / 0 |