| id | C00002586 |
|---|---|
| Name | Wighteone / Erythrinin B / 5,7,4'-Trihydroxy-6-prenylisoflavone |
| CAS RN | 51225-30-0 |
| Standard InChI | InChI=1S/C20H18O5/c1-11(2)3-8-14-16(22)9-17-18(19(14)23)20(24)15(10-25-17)12-4-6-13(21)7-5-12/h3-7,9-10,21-23H,8H2,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C20H18O5/c1-11(2)3-8-14-16(22)9-17-18(19(14)23)20(24)15(10-25-17)12-4-6-13(21)7-5-12/h3-7,9-10,21-23H,8H2,1-2H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 15 |
| By standard InChI | CHEMBL393222 |
|---|---|
| By standard InChI Main Layer | CHEMBL393222 |
| By LinkDB | C10542 |
|---|
| By CAS RN |
|---|
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q92731 | Estrogen receptor beta | NR3A2 | CHEMBL393222 |
CHEMBL1106814
(1)
|
0 / 1 |
| P03372 | Estrogen receptor | NR3A1 | CHEMBL393222 |
CHEMBL1106813
(1)
|
1 / 1 |